Camellioside A
Internal ID | f375a2da-2ff3-4416-b65e-cee08c788dcf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,6aR,6bS,8aR,12aS,14aR,14bR)-8a-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-8-oxo-2,3,4a,5,6,7,9,10,12,12a,14,14a-dodecahydro-1H-picen-3-yl]oxy]-4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2=O)C)C)(C)C)OC6C(C(C(C(O6)C(=O)O)O)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)CO)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)O)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C(C1CC[C@@]3([C@@H]2CC=C4[C@]3(CC(=O)[C@@]5([C@H]4CC(CC5)(C)C)O)C)C)(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O[C@@H]9[C@H]([C@@H]([C@@H]([C@@H](O9)CO)O)O)O |
InChI | InChI=1S/C53H84O24/c1-48(2)14-15-53(69)22(16-48)21-8-9-27-50(5)12-11-29(49(3,4)26(50)10-13-51(27,6)52(21,7)17-28(53)57)73-47-42(77-45-37(65)34(62)31(59)24(19-55)71-45)39(38(66)40(75-47)43(67)68)74-46-41(35(63)32(60)25(20-56)72-46)76-44-36(64)33(61)30(58)23(18-54)70-44/h8,22-27,29-42,44-47,54-56,58-66,69H,9-20H2,1-7H3,(H,67,68)/t22-,23+,24-,25+,26?,27+,29-,30+,31+,32-,33-,34+,35-,36+,37-,38-,39-,40-,41+,42+,44-,45+,46-,47+,50-,51+,52+,53+/m0/s1 |
InChI Key | VSPSMYBTMQXXMU-RCWPBRCDSA-N |
Popularity | 3 references in papers |
Molecular Formula | C53H84O24 |
Molecular Weight | 1105.20 g/mol |
Exact Mass | 1104.53525354 g/mol |
Topological Polar Surface Area (TPSA) | 391.00 Ų |
XlogP | -0.30 |
CHEMBL1289020 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.84% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.20% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.06% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.51% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.08% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.41% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.81% | 97.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.43% | 92.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.31% | 93.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.58% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.74% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.16% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.88% | 90.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.28% | 99.17% |
CHEMBL220 | P22303 | Acetylcholinesterase | 80.27% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia japonica |
PubChem | 52949900 |
LOTUS | LTS0109553 |
wikiData | Q105292422 |