Calystegine B1
| Internal ID | 47cff863-b755-4679-a39b-2efd9e1d81ad |
| Taxonomy | Alkaloids and derivatives > Tropane alkaloids |
| IUPAC Name | (1R,2S,3R,5S,6S)-8-azabicyclo[3.2.1]octane-1,2,3,6-tetrol |
| SMILES (Canonical) | C1C2C(CC(N2)(C(C1O)O)O)O |
| SMILES (Isomeric) | C1[C@H]2[C@H](C[C@](N2)([C@H]([C@@H]1O)O)O)O |
| InChI | InChI=1S/C7H13NO4/c9-4-1-3-5(10)2-7(12,8-3)6(4)11/h3-6,8-12H,1-2H2/t3-,4+,5-,6-,7+/m0/s1 |
| InChI Key | BQFFLYRIKODYEN-MLKOFDEISA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 93.00 Ų |
| XlogP | -2.40 |
| CHEMBL1965915 |
| (1r,2s,3r,5s,6s)-8-azabicyclo[3.2.1]octane-1,2,3,6-tetrol |
| NSC677084 |
| NSC-677084 |
| NCI60_027467 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.29% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.27% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.84% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.75% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.49% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.90% | 95.93% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.28% | 94.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.16% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ipomoea alba |
| Mandragora officinarum |
| Nicandra physalodes |
| PubChem | 385736 |
| LOTUS | LTS0126311 |
| wikiData | Q105101459 |