Cajanol
Internal ID | 04abb5da-c8f3-45fa-9431-d0574b082ab8 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > O-methylated isoflavonoids > 7-O-methylated isoflavonoids |
IUPAC Name | 5-hydroxy-3-(4-hydroxy-2-methoxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC(=C2C(=C1)OCC(C2=O)C3=C(C=C(C=C3)O)OC)O |
SMILES (Isomeric) | COC1=CC(=C2C(=C1)OCC(C2=O)C3=C(C=C(C=C3)O)OC)O |
InChI | InChI=1S/C17H16O6/c1-21-10-6-13(19)16-15(7-10)23-8-12(17(16)20)11-4-3-9(18)5-14(11)22-2/h3-7,12,18-19H,8H2,1-2H3 |
InChI Key | RYYWWFXWFMYKJM-UHFFFAOYSA-N |
Popularity | 12 references in papers |
Molecular Formula | C17H16O6 |
Molecular Weight | 316.30 g/mol |
Exact Mass | 316.09468823 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 2.90 |
61020-70-0 |
UNII-U192S21MNA |
U192S21MNA |
2,3-DIHYDRO-5-HYDROXY-3-(4-HYDROXY-2-METHOXYPHENYL)-7-METHOXY-4H-1-BENZOPYRAN-4-ONE |
SCHEMBL571648 |
DTXSID00976519 |
LMPK12050499 |
5-hydroxy-3-(4-hydroxy-2-methoxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
XC161666 |
4',5-Dihydroxy-2',7-dimethoxyisoflavanone |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.72% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.97% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.76% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.64% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.25% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.29% | 99.15% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.24% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.64% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 90.35% | 98.75% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.64% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.58% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.55% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.97% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.50% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.05% | 90.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.72% | 94.80% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.68% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.52% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.00% | 99.17% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.68% | 100.00% |
CHEMBL240 | Q12809 | HERG | 83.24% | 89.76% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.06% | 93.40% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.37% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.55% | 92.62% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 81.50% | 82.67% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.90% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cajanus cajan |
Crotalaria lachnophora |
PubChem | 442670 |
LOTUS | LTS0076499 |
wikiData | Q104393740 |