[10-Acetyloxy-1,1-dimethyl-4,9-dioxo-7-(3-oxoprop-1-en-2-yl)-4b,5,6,7,8,8a,10,10a-octahydrophenanthren-4a-yl]methyl acetate
Internal ID | 7962bfc8-df5a-4eda-b32e-ed67c280f4dc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [10-acetyloxy-1,1-dimethyl-4,9-dioxo-7-(3-oxoprop-1-en-2-yl)-4b,5,6,7,8,8a,10,10a-octahydrophenanthren-4a-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC12C3CCC(CC3C(=O)C(C1C(C=CC2=O)(C)C)OC(=O)C)C(=C)C=O |
SMILES (Isomeric) | CC(=O)OCC12C3CCC(CC3C(=O)C(C1C(C=CC2=O)(C)C)OC(=O)C)C(=C)C=O |
InChI | InChI=1S/C24H30O7/c1-13(11-25)16-6-7-18-17(10-16)20(29)21(31-15(3)27)22-23(4,5)9-8-19(28)24(18,22)12-30-14(2)26/h8-9,11,16-18,21-22H,1,6-7,10,12H2,2-5H3 |
InChI Key | PAXFBCGUYYUOHL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H30O7 |
Molecular Weight | 430.50 g/mol |
Exact Mass | 430.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 2.60 |
There are no found synonyms. |
![2D Structure of [10-Acetyloxy-1,1-dimethyl-4,9-dioxo-7-(3-oxoprop-1-en-2-yl)-4b,5,6,7,8,8a,10,10a-octahydrophenanthren-4a-yl]methyl acetate 2D Structure of [10-Acetyloxy-1,1-dimethyl-4,9-dioxo-7-(3-oxoprop-1-en-2-yl)-4b,5,6,7,8,8a,10,10a-octahydrophenanthren-4a-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/ca818880-868a-11ee-98dc-99659a8348df.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.63% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.24% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.17% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.18% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.87% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.31% | 82.69% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.55% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.44% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 87.31% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.63% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.99% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.20% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.94% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.79% | 90.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.87% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon longitubus |
PubChem | 14137597 |
LOTUS | LTS0266988 |
wikiData | Q105204922 |