(3a,5a,5b,8,8,11a-Hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl) 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | b3eee71f-53fb-4130-9ecd-fadff770b5ee |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl) 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)OC(=O)C=CC6=CC(=C(C=C6)O)OC)C)C |
SMILES (Isomeric) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)OC(=O)C=CC6=CC(=C(C=C6)O)OC)C)C |
InChI | InChI=1S/C40H58O4/c1-25(2)27-16-19-37(5)22-23-39(7)28(35(27)37)12-14-32-38(6)20-18-33(36(3,4)31(38)17-21-40(32,39)8)44-34(42)15-11-26-10-13-29(41)30(24-26)43-9/h10-11,13,15,24,27-28,31-33,35,41H,1,12,14,16-23H2,2-9H3 |
InChI Key | CWBPOOVULYCSDV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H58O4 |
Molecular Weight | 602.90 g/mol |
Exact Mass | 602.43351033 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 12.10 |
There are no found synonyms. |
![2D Structure of (3a,5a,5b,8,8,11a-Hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl) 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate 2D Structure of (3a,5a,5b,8,8,11a-Hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl) 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/ca24b5c0-8586-11ee-ae50-8faa691e917b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.07% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.81% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 97.21% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.98% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.85% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.54% | 95.56% |
CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 91.74% | 83.65% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.17% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.90% | 89.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.83% | 92.62% |
CHEMBL3194 | P02766 | Transthyretin | 87.41% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.78% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.27% | 91.19% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 84.87% | 85.30% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.18% | 91.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.06% | 97.09% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.76% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 83.59% | 98.75% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.22% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.42% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.17% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.51% | 97.14% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.04% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ceriops decandra |
Ceriops tagal |
PubChem | 162887614 |
LOTUS | LTS0188953 |
wikiData | Q104971145 |