2-[[17-(5-ethyl-3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 896bced2-391f-4064-ac7e-de85b31ba1ca |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | 2-[[17-(5-ethyl-3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CCC(CC(C(C)C1CCC2C1(CC=C3C2=CCC4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)O)C(C)C |
SMILES (Isomeric) | CCC(CC(C(C)C1CCC2C1(CC=C3C2=CCC4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)O)C(C)C |
InChI | InChI=1S/C35H58O7/c1-7-21(19(2)3)16-28(37)20(4)25-10-11-26-24-9-8-22-17-23(12-14-34(22,5)27(24)13-15-35(25,26)6)41-33-32(40)31(39)30(38)29(18-36)42-33/h9,13,19-23,25-26,28-33,36-40H,7-8,10-12,14-18H2,1-6H3 |
InChI Key | BJFNQYYKDGQJNK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H58O7 |
Molecular Weight | 590.80 g/mol |
Exact Mass | 590.41825418 g/mol |
Topological Polar Surface Area (TPSA) | 120.00 Ų |
XlogP | 5.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.67% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.98% | 96.09% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 96.92% | 94.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.78% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.32% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 93.75% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.75% | 95.93% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 92.47% | 97.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.71% | 95.89% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 88.28% | 94.97% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.42% | 100.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.95% | 94.08% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.57% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.52% | 93.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.26% | 100.00% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 85.97% | 98.35% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 84.79% | 97.64% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.37% | 86.92% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.33% | 89.00% |
CHEMBL1977 | P11473 | Vitamin D receptor | 83.31% | 99.43% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.55% | 90.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.38% | 98.10% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.96% | 98.05% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.12% | 94.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.78% | 97.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.77% | 96.21% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.49% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buddleja crispa |
PubChem | 73086298 |
LOTUS | LTS0137675 |
wikiData | Q104937062 |