5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | e9d8568e-4d90-429a-83e2-476f2a34659f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C(=C5)OC)O)OC)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C(=C5)OC)O)OC)O)O)O)O)O)O |
InChI | InChI=1S/C29H34O17/c1-9-18(32)22(36)24(38)28(43-9)42-8-16-20(34)23(37)25(39)29(45-16)46-27-21(35)17-12(31)6-11(30)7-13(17)44-26(27)10-4-14(40-2)19(33)15(5-10)41-3/h4-7,9,16,18,20,22-25,28-34,36-39H,8H2,1-3H3 |
InChI Key | BWDMLCWSGGUHGK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H34O17 |
Molecular Weight | 654.60 g/mol |
Exact Mass | 654.17959961 g/mol |
Topological Polar Surface Area (TPSA) | 264.00 Ų |
XlogP | -1.00 |
FT-0775717 |
![2D Structure of 5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/c8daabf0-860e-11ee-8f48-a1c2f066957b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.65% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.40% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.05% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.16% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.94% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.27% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.40% | 94.73% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.11% | 95.64% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.02% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.58% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.10% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 86.44% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.47% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.84% | 95.89% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.78% | 94.03% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.28% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.98% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.62% | 91.49% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.10% | 92.94% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.04% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catharanthus roseus |
PubChem | 73157308 |
LOTUS | LTS0178754 |
wikiData | Q104947132 |