(1'R,2'S,4'S,5S,5'R,9'S,10'S,13'R)-1-[2-[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2'-acetyloxy-5',9'-dimethyl-15'-oxospiro[cyclohexene-5,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylic acid
Internal ID | 5fc362f8-13d9-470f-a18c-8f3dde931c2e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1'R,2'S,4'S,5S,5'R,9'S,10'S,13'R)-1-[2-[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2'-acetyloxy-5',9'-dimethyl-15'-oxospiro[cyclohexene-5,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylic acid |
SMILES (Canonical) | CC(=O)OC1CC2C(CCCC2(C)C(=O)O)(C3C14CC(CC3)C5(C4=O)CCC=C(C5)CCC6C(=C)CCC7C6(CCCC7(C)C)C)C |
SMILES (Isomeric) | CC(=O)O[C@H]1C[C@H]2[C@@](CCC[C@@]2(C)C(=O)O)([C@H]3[C@]14C[C@@H](CC3)[C@]5(C4=O)CCC=C(C5)CC[C@@H]6C(=C)CC[C@H]7[C@]6(CCCC7(C)C)C)C |
InChI | InChI=1S/C42H62O5/c1-26-12-16-31-37(3,4)18-9-19-38(31,5)30(26)15-13-28-11-8-22-41(24-28)29-14-17-32-39(6)20-10-21-40(7,36(45)46)33(39)23-34(47-27(2)43)42(32,25-29)35(41)44/h11,29-34H,1,8-10,12-25H2,2-7H3,(H,45,46)/t29-,30-,31-,32+,33+,34+,38+,39+,40-,41+,42-/m1/s1 |
InChI Key | IASPGVMFMPHFQS-DJHAOSCOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H62O5 |
Molecular Weight | 646.90 g/mol |
Exact Mass | 646.45972507 g/mol |
Topological Polar Surface Area (TPSA) | 80.70 Ų |
XlogP | 9.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.41% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.48% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.42% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.90% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.79% | 96.09% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 91.00% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.41% | 95.50% |
CHEMBL2581 | P07339 | Cathepsin D | 89.11% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.77% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.47% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.98% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.75% | 95.56% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.46% | 95.17% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.98% | 93.04% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.65% | 86.33% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.23% | 94.08% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.75% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.95% | 95.89% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.18% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Xylopia emarginata |
PubChem | 162988034 |
LOTUS | LTS0106412 |
wikiData | Q105036271 |