(10R,11S)-3,4,5,16,17,18-hexahydroxy-8,13-dioxo-11-[(10S,11S)-3,4,5,11,17,18,19,22,23,34,35-undecahydroxy-8,14,26,31-tetraoxo-9,13,25,32-tetraoxaheptacyclo[25.8.0.02,7.015,20.021,30.024,29.028,33]pentatriaconta-1(35),2,4,6,15,17,19,21,23,27,29,33-dodecaen-10-yl]-9,12-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,14,16-hexaene-10-carbaldehyde
Internal ID | e9343fde-bbfd-4bd5-aa15-050a1ea79bbb |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (10R,11S)-3,4,5,16,17,18-hexahydroxy-8,13-dioxo-11-[(10S,11S)-3,4,5,11,17,18,19,22,23,34,35-undecahydroxy-8,14,26,31-tetraoxo-9,13,25,32-tetraoxaheptacyclo[25.8.0.02,7.015,20.021,30.024,29.028,33]pentatriaconta-1(35),2,4,6,15,17,19,21,23,27,29,33-dodecaen-10-yl]-9,12-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,14,16-hexaene-10-carbaldehyde |
SMILES (Canonical) | C1C(C(OC(=O)C2=CC(=C(C(=C2C3=C(C(=C4C5=C3C(=O)OC6=C(C(=C(C7=C(C(=C(C=C7C(=O)O1)O)O)O)C(=C56)C(=O)O4)O)O)O)O)O)O)O)C8C(OC(=O)C9=CC(=C(C(=C9C1=C(C(=C(C=C1C(=O)O8)O)O)O)O)O)O)C=O)O |
SMILES (Isomeric) | C1[C@@H]([C@H](OC(=O)C2=CC(=C(C(=C2C3=C(C(=C4C5=C3C(=O)OC6=C(C(=C(C7=C(C(=C(C=C7C(=O)O1)O)O)O)C(=C56)C(=O)O4)O)O)O)O)O)O)O)[C@H]8[C@@H](OC(=O)C9=CC(=C(C(=C9C1=C(C(=C(C=C1C(=O)O8)O)O)O)O)O)O)C=O)O |
InChI | InChI=1S/C48H28O30/c49-5-16-40(76-46(70)9-3-13(52)28(56)32(60)18(9)17-8(44(68)74-16)2-12(51)27(55)31(17)59)39-15(54)6-73-43(67)7-1-11(50)29(57)33(61)19(7)21-25-23-24-26(48(72)78-41(23)37(65)35(21)63)22(36(64)38(66)42(24)77-47(25)71)20-10(45(69)75-39)4-14(53)30(58)34(20)62/h1-5,15-16,39-40,50-66H,6H2/t15-,16-,39-,40+/m0/s1 |
InChI Key | SKNLUADAGHCXKF-OGMSSRDFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H28O30 |
Molecular Weight | 1084.70 g/mol |
Exact Mass | 1084.06653947 g/mol |
Topological Polar Surface Area (TPSA) | 519.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.27% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.99% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.45% | 89.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.98% | 89.34% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.99% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.57% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.54% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.25% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.28% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 84.16% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.02% | 85.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.61% | 100.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.60% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.12% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.25% | 97.09% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.89% | 89.63% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.80% | 99.15% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 80.65% | 98.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Punica granatum |
PubChem | 154497312 |
LOTUS | LTS0087781 |
wikiData | Q105254934 |