methyl (6R,7S,8R)-10-methoxy-6-(4-methoxyphenyl)-8-[(2S)-2-[[(2R)-2-methylbutanoyl]amino]pyrrolidine-1-carbonyl]-9-oxo-7-phenyl-7,8-dihydro-[1,3]dioxolo[4,5-h][1]benzoxepine-6-carboxylate
Internal ID | bf668acb-f5e2-42a1-bebd-63a9587b065e |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | methyl (6R,7S,8R)-10-methoxy-6-(4-methoxyphenyl)-8-[(2S)-2-[[(2R)-2-methylbutanoyl]amino]pyrrolidine-1-carbonyl]-9-oxo-7-phenyl-7,8-dihydro-[1,3]dioxolo[4,5-h][1]benzoxepine-6-carboxylate |
SMILES (Canonical) | CCC(C)C(=O)NC1CCCN1C(=O)C2C(C(OC3=CC4=C(C(=C3C2=O)OC)OCO4)(C5=CC=C(C=C5)OC)C(=O)OC)C6=CC=CC=C6 |
SMILES (Isomeric) | CC[C@@H](C)C(=O)N[C@@H]1CCCN1C(=O)[C@@H]2[C@H]([C@@](OC3=CC4=C(C(=C3C2=O)OC)OCO4)(C5=CC=C(C=C5)OC)C(=O)OC)C6=CC=CC=C6 |
InChI | InChI=1S/C37H40N2O10/c1-6-21(2)34(41)38-27-13-10-18-39(27)35(42)29-30(22-11-8-7-9-12-22)37(36(43)46-5,23-14-16-24(44-3)17-15-23)49-25-19-26-32(48-20-47-26)33(45-4)28(25)31(29)40/h7-9,11-12,14-17,19,21,27,29-30H,6,10,13,18,20H2,1-5H3,(H,38,41)/t21-,27+,29-,30-,37+/m1/s1 |
InChI Key | OCAUDZRWYYOTLH-XHFILGSTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H40N2O10 |
Molecular Weight | 672.70 g/mol |
Exact Mass | 672.26829548 g/mol |
Topological Polar Surface Area (TPSA) | 139.00 Ų |
XlogP | 6.00 |
There are no found synonyms. |
![2D Structure of methyl (6R,7S,8R)-10-methoxy-6-(4-methoxyphenyl)-8-[(2S)-2-[[(2R)-2-methylbutanoyl]amino]pyrrolidine-1-carbonyl]-9-oxo-7-phenyl-7,8-dihydro-[1,3]dioxolo[4,5-h][1]benzoxepine-6-carboxylate 2D Structure of methyl (6R,7S,8R)-10-methoxy-6-(4-methoxyphenyl)-8-[(2S)-2-[[(2R)-2-methylbutanoyl]amino]pyrrolidine-1-carbonyl]-9-oxo-7-phenyl-7,8-dihydro-[1,3]dioxolo[4,5-h][1]benzoxepine-6-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/c7c7c920-853f-11ee-a441-5db9c9bbca12.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.78% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.42% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 97.33% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.09% | 96.77% |
CHEMBL4208 | P20618 | Proteasome component C5 | 96.86% | 90.00% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 96.09% | 96.76% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.83% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 94.33% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.19% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.15% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.94% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.65% | 95.89% |
CHEMBL205 | P00918 | Carbonic anhydrase II | 88.89% | 98.44% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.16% | 96.47% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.03% | 99.18% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.62% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.41% | 96.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.08% | 96.38% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.94% | 93.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.44% | 92.88% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.28% | 91.07% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.09% | 99.23% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.71% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.24% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.79% | 93.99% |
CHEMBL2535 | P11166 | Glucose transporter | 83.66% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.27% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.13% | 90.17% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.49% | 95.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.66% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.51% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.40% | 97.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.21% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia edulis |
PubChem | 162887137 |
LOTUS | LTS0195324 |
wikiData | Q105189256 |