[4-(2-Methoxy-2-oxoacetyl)-5-(2-methoxy-2-oxoethylidene)-7,8-dimethyl-2,13,15-trioxatetracyclo[8.6.1.04,17.012,16]heptadeca-1(17),10,12(16)-trien-9-yl] 2-methylbut-2-enoate
Internal ID | de4eec87-56d9-4f18-b9d5-317642afe660 |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | [4-(2-methoxy-2-oxoacetyl)-5-(2-methoxy-2-oxoethylidene)-7,8-dimethyl-2,13,15-trioxatetracyclo[8.6.1.04,17.012,16]heptadeca-1(17),10,12(16)-trien-9-yl] 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C(CC(=CC(=O)OC)C2(COC3=C2C1=CC4=C3OCO4)C(=O)C(=O)OC)C)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1C(C(CC(=CC(=O)OC)C2(COC3=C2C1=CC4=C3OCO4)C(=O)C(=O)OC)C)C |
InChI | InChI=1S/C27H30O10/c1-7-13(2)25(30)37-21-15(4)14(3)8-16(9-19(28)32-5)27(24(29)26(31)33-6)11-34-23-20(27)17(21)10-18-22(23)36-12-35-18/h7,9-10,14-15,21H,8,11-12H2,1-6H3 |
InChI Key | WZHLOZOCPVZWTE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O10 |
Molecular Weight | 514.50 g/mol |
Exact Mass | 514.18389715 g/mol |
Topological Polar Surface Area (TPSA) | 124.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |
![2D Structure of [4-(2-Methoxy-2-oxoacetyl)-5-(2-methoxy-2-oxoethylidene)-7,8-dimethyl-2,13,15-trioxatetracyclo[8.6.1.04,17.012,16]heptadeca-1(17),10,12(16)-trien-9-yl] 2-methylbut-2-enoate 2D Structure of [4-(2-Methoxy-2-oxoacetyl)-5-(2-methoxy-2-oxoethylidene)-7,8-dimethyl-2,13,15-trioxatetracyclo[8.6.1.04,17.012,16]heptadeca-1(17),10,12(16)-trien-9-yl] 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/c75258e0-857a-11ee-bdde-0b9a35d20c15.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.09% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.07% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.45% | 94.45% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.27% | 94.80% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.98% | 96.77% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.68% | 98.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.93% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.93% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.88% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.15% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.37% | 92.62% |
CHEMBL2581 | P07339 | Cathepsin D | 84.81% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.91% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.83% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.44% | 99.23% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.00% | 95.50% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.98% | 89.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.51% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 81.10% | 97.50% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.97% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.44% | 94.33% |
CHEMBL2535 | P11166 | Glucose transporter | 80.10% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura heteroclita |
Kadsura japonica |
PubChem | 75049128 |
LOTUS | LTS0187374 |
wikiData | Q105323166 |