(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4R,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4'-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one
Internal ID | 04a9fe1b-0029-4312-8dcd-d6f0b259611a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4R,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4'-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one |
SMILES (Canonical) | CC1COC2(CC1O)C(C3C(O2)CC4C3(C(=O)CC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)O)O)O)O)C)C)C |
SMILES (Isomeric) | C[C@@H]1CO[C@@]2(CC1O)[C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(C(=O)C[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O)C)C)C |
InChI | InChI=1S/C39H60O15/c1-16-15-49-39(12-23(16)42)17(2)28-24(54-39)10-22-20-6-5-18-9-19(7-8-37(18,3)21(20)11-27(43)38(22,28)4)50-35-33(48)31(46)34(26(14-41)52-35)53-36-32(47)30(45)29(44)25(13-40)51-36/h5,16-17,19-26,28-36,40-42,44-48H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23?,24+,25-,26-,28+,29-,30+,31-,32-,33-,34+,35-,36+,37+,38-,39-/m1/s1 |
InChI Key | SMEZATBOVGHWIY-BTFRSUAVSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C39H60O15 |
Molecular Weight | 768.90 g/mol |
Exact Mass | 768.39322120 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.40% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.82% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.25% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.94% | 100.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.77% | 85.14% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.48% | 95.93% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 90.23% | 95.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.11% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 88.67% | 98.95% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.92% | 91.24% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.70% | 92.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.92% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.89% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.65% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.29% | 94.45% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.57% | 95.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.24% | 93.04% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.98% | 95.56% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.41% | 94.23% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.40% | 93.56% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.35% | 96.90% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.64% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygonatum kingianum |
PubChem | 101481808 |
LOTUS | LTS0172284 |
wikiData | Q105255864 |