[(2S,3S,4R,5S,6S)-6-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-6-methyloxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate
Internal ID | c8edbb1b-c626-48eb-b7a0-f2420f74fd53 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(2S,3S,4R,5S,6S)-6-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-6-methyloxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)OC4C(C(C(C(O4)CO)O)O)O)O)C5=CC=C(C=C5)OC)O)OC6C(C(C(C(O6)COC(=O)C)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)C5=CC=C(C=C5)OC)O)O[C@H]6[C@H]([C@@H]([C@@H]([C@@H](O6)COC(=O)C)O)O)O)O |
InChI | InChI=1S/C41H52O21/c1-15(2)6-11-20-22(57-39-32(51)30(49)27(46)23(13-42)58-39)12-21(44)25-29(48)38(35(60-36(20)25)18-7-9-19(54-5)10-8-18)62-41-34(53)37(26(45)16(3)56-41)61-40-33(52)31(50)28(47)24(59-40)14-55-17(4)43/h6-10,12,16,23-24,26-28,30-34,37,39-42,44-47,49-53H,11,13-14H2,1-5H3/t16-,23-,24+,26-,27-,28-,30+,31-,32-,33+,34+,37+,39-,40+,41-/m1/s1 |
InChI Key | SCGIMZSPRPPEMA-LTWUEXIQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H52O21 |
Molecular Weight | 880.80 g/mol |
Exact Mass | 880.30010866 g/mol |
Topological Polar Surface Area (TPSA) | 320.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
![2D Structure of [(2S,3S,4R,5S,6S)-6-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-6-methyloxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate 2D Structure of [(2S,3S,4R,5S,6S)-6-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-6-methyloxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/c7357600-8586-11ee-871a-95c279fdabe1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.86% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.25% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.22% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.15% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.48% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.28% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.29% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.04% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.82% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.33% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.76% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.93% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.54% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.80% | 86.92% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.08% | 96.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.75% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.38% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.35% | 96.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.27% | 94.80% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.67% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.59% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vancouveria hexandra |
PubChem | 162923135 |
LOTUS | LTS0085712 |
wikiData | Q105250097 |