(4aR,5S,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-5-[(Z)-2-methylbut-2-enoyl]oxy-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid
Internal ID | 0945a4bf-6931-4727-a6c2-e537fbb1005c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4aR,5S,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-5-[(Z)-2-methylbut-2-enoyl]oxy-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC2(C(=CCC3C2(CCC4C3(CCC(=O)C4(C)C)C)C)C5C1(CCC(C5)(C)C)C(=O)O)C |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1C[C@@]2(C(=CC[C@H]3[C@]2(CC[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)C)[C@H]5[C@@]1(CCC(C5)(C)C)C(=O)O)C |
InChI | InChI=1S/C35H52O5/c1-10-21(2)28(37)40-27-20-34(9)22(23-19-30(3,4)17-18-35(23,27)29(38)39)11-12-25-32(7)15-14-26(36)31(5,6)24(32)13-16-33(25,34)8/h10-11,23-25,27H,12-20H2,1-9H3,(H,38,39)/b21-10-/t23-,24-,25+,27-,32-,33+,34+,35+/m0/s1 |
InChI Key | BOPSWTKHUBYVHB-CPUYKNEDSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H52O5 |
Molecular Weight | 552.80 g/mol |
Exact Mass | 552.38147475 g/mol |
Topological Polar Surface Area (TPSA) | 80.70 Ų |
XlogP | 7.80 |
There are no found synonyms. |
![2D Structure of (4aR,5S,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-5-[(Z)-2-methylbut-2-enoyl]oxy-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid 2D Structure of (4aR,5S,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-5-[(Z)-2-methylbut-2-enoyl]oxy-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/c63075c0-84e4-11ee-9ee3-5198ad9903b9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.80% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.26% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.29% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.99% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.85% | 93.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.45% | 99.23% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.13% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.30% | 97.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.00% | 92.98% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.91% | 82.69% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.81% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.70% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.18% | 90.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.66% | 92.94% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.56% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.89% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lantana camara |
PubChem | 163005257 |
LOTUS | LTS0076743 |
wikiData | Q104939389 |