2-(Hydroxymethyl)-6-[[3,4,5-trihydroxy-6-[[6-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-2-yl]methoxy]oxane-3,4,5-triol
Internal ID | 852bad09-db06-4519-a30d-7fb97701d077 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-(hydroxymethyl)-6-[[3,4,5-trihydroxy-6-[[6-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-2-yl]methoxy]oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)O |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)O |
InChI | InChI=1S/C45H76O19/c1-19(17-58-40-37(54)34(51)31(48)27(15-46)61-40)7-12-45(57)20(2)30-26(64-45)14-25-23-6-5-21-13-22(8-10-43(21,3)24(23)9-11-44(25,30)4)60-42-39(56)36(53)33(50)29(63-42)18-59-41-38(55)35(52)32(49)28(16-47)62-41/h19-42,46-57H,5-18H2,1-4H3 |
InChI Key | XDJRIVOSNYPOEY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H76O19 |
Molecular Weight | 921.10 g/mol |
Exact Mass | 920.49808019 g/mol |
Topological Polar Surface Area (TPSA) | 307.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |
![2D Structure of 2-(Hydroxymethyl)-6-[[3,4,5-trihydroxy-6-[[6-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-2-yl]methoxy]oxane-3,4,5-triol 2D Structure of 2-(Hydroxymethyl)-6-[[3,4,5-trihydroxy-6-[[6-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-2-yl]methoxy]oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/c5fa15c0-864a-11ee-9446-81e2516d0b99.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.23% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.14% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.18% | 97.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.30% | 92.86% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 94.36% | 89.05% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.16% | 96.21% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.93% | 97.25% |
CHEMBL237 | P41145 | Kappa opioid receptor | 92.94% | 98.10% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.23% | 94.45% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.13% | 95.93% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 91.79% | 97.79% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.72% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.37% | 94.45% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 91.27% | 93.18% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.52% | 100.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 89.42% | 97.93% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.09% | 98.05% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.07% | 95.36% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.68% | 96.47% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.54% | 92.98% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.20% | 96.43% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 85.98% | 98.46% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.69% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.10% | 95.50% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 84.69% | 100.00% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.57% | 92.32% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 84.12% | 92.50% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 83.98% | 97.64% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.27% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.03% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.88% | 100.00% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 82.65% | 98.35% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.08% | 82.50% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.72% | 97.29% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.66% | 93.56% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 81.64% | 87.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.12% | 89.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.84% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helleborus viridis |
PubChem | 75032158 |
LOTUS | LTS0267035 |
wikiData | Q105325767 |