(2,12-Dimethyl-6-methylidene-7,17-dioxo-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecan-5-yl) 6-hydroxy-2,12-dimethyl-17-oxo-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-6-carboxylate
| Internal ID | bceb5e4f-c305-4008-9a49-2ceadf3673a8 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | (2,12-dimethyl-6-methylidene-7,17-dioxo-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecan-5-yl) 6-hydroxy-2,12-dimethyl-17-oxo-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-6-carboxylate |
| SMILES (Canonical) | CC12CCCC3(C1CCC45C3(CCC(C4)C(C5)(C(=O)OC67CCC8(C(C6)(CCC9C81CCCC9(C(=O)O1)C)C(=O)C7=C)C)O)C)OC2=O |
| SMILES (Isomeric) | CC12CCCC3(C1CCC45C3(CCC(C4)C(C5)(C(=O)OC67CCC8(C(C6)(CCC9C81CCCC9(C(=O)O1)C)C(=O)C7=C)C)O)C)OC2=O |
| InChI | InChI=1S/C40H52O8/c1-23-27(41)36-17-10-26-32(3)12-7-14-40(26,48-29(32)43)34(36,5)18-19-37(23,22-36)46-30(44)38(45)21-35-16-9-25-31(2)11-6-13-39(25,47-28(31)42)33(35,4)15-8-24(38)20-35/h24-26,45H,1,6-22H2,2-5H3 |
| InChI Key | YECCQPBETSFSNY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H52O8 |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.36621861 g/mol |
| Topological Polar Surface Area (TPSA) | 116.00 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.03% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.20% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.85% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.32% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.29% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.26% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.60% | 91.19% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.17% | 91.07% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.79% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.70% | 85.14% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.32% | 95.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.29% | 97.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.95% | 96.38% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 82.35% | 90.24% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.92% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.91% | 95.56% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.87% | 82.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.43% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.21% | 95.89% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.19% | 94.33% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.24% | 93.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.08% | 97.14% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.00% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Parinari campestris |
| PubChem | 162930625 |
| LOTUS | LTS0077581 |
| wikiData | Q105347151 |