[11,16-Diacetyloxy-13-(furan-3-yl)-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-4-(2-methylpropanoyloxy)-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-5-yl] pyridine-3-carboxylate;[11,16-diacetyloxy-13-(furan-3-yl)-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-5-(2-methylpropanoyloxy)-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-4-yl] pyridine-3-carboxylate
Internal ID | 4287040e-51b4-4262-87d1-b717959b18e6 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
IUPAC Name | [11,16-diacetyloxy-13-(furan-3-yl)-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-4-(2-methylpropanoyloxy)-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-5-yl] pyridine-3-carboxylate;[11,16-diacetyloxy-13-(furan-3-yl)-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-5-(2-methylpropanoyloxy)-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-4-yl] pyridine-3-carboxylate |
SMILES (Canonical) | CC(C)C(=O)OC1C2C(C(C(C1OC(=O)C3=CN=CC=C3)(C)C)CC(=O)OC)(C(=O)C4C(C5(C(OC(=O)C(C5(C4=C)O2)OC(=O)C)C6=COC=C6)C)OC(=O)C)C.CC(C)C(=O)OC1C(C2C(C(C1(C)C)CC(=O)OC)(C(=O)C3C(C4(C(OC(=O)C(C4(C3=C)O2)OC(=O)C)C5=COC=C5)C)OC(=O)C)C)OC(=O)C6=CN=CC=C6 |
SMILES (Isomeric) | CC(C)C(=O)OC1C2C(C(C(C1OC(=O)C3=CN=CC=C3)(C)C)CC(=O)OC)(C(=O)C4C(C5(C(OC(=O)C(C5(C4=C)O2)OC(=O)C)C6=COC=C6)C)OC(=O)C)C.CC(C)C(=O)OC1C(C2C(C(C1(C)C)CC(=O)OC)(C(=O)C3C(C4(C(OC(=O)C(C4(C3=C)O2)OC(=O)C)C5=COC=C5)C)OC(=O)C)C)OC(=O)C6=CN=CC=C6 |
InChI | InChI=1S/2C41H47NO15/c1-19(2)35(47)56-32-28(54-36(48)23-12-11-14-42-17-23)33-39(8,25(38(32,6)7)16-26(45)50-10)29(46)27-20(3)41(57-33)34(53-22(5)44)37(49)55-30(24-13-15-51-18-24)40(41,9)31(27)52-21(4)43;1-19(2)35(47)54-28-32(56-36(48)23-12-11-14-42-17-23)38(6,7)25(16-26(45)50-10)39(8)29(46)27-20(3)41(57-33(28)39)34(53-22(5)44)37(49)55-30(24-13-15-51-18-24)40(41,9)31(27)52-21(4)43/h2*11-15,17-19,25,27-28,30-34H,3,16H2,1-2,4-10H3 |
InChI Key | LPTILUWVUAGWRC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C82H94N2O30 |
Molecular Weight | 1587.60 g/mol |
Exact Mass | 1586.58913958 g/mol |
Topological Polar Surface Area (TPSA) | 420.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of [11,16-Diacetyloxy-13-(furan-3-yl)-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-4-(2-methylpropanoyloxy)-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-5-yl] pyridine-3-carboxylate;[11,16-diacetyloxy-13-(furan-3-yl)-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-5-(2-methylpropanoyloxy)-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-4-yl] pyridine-3-carboxylate 2D Structure of [11,16-Diacetyloxy-13-(furan-3-yl)-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-4-(2-methylpropanoyloxy)-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-5-yl] pyridine-3-carboxylate;[11,16-diacetyloxy-13-(furan-3-yl)-7-(2-methoxy-2-oxoethyl)-6,6,8,12-tetramethyl-17-methylidene-5-(2-methylpropanoyloxy)-9,15-dioxo-2,14-dioxatetracyclo[8.6.1.01,12.03,8]heptadecan-4-yl] pyridine-3-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/c5df8eb0-876f-11ee-9211-9339d8f75669.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.29% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.60% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.32% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.72% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.61% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.45% | 94.45% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 93.50% | 97.79% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 92.00% | 94.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 91.48% | 94.80% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.30% | 99.23% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 91.03% | 91.07% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.37% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.29% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.54% | 98.95% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 88.96% | 85.30% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.45% | 89.34% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.45% | 95.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.44% | 92.62% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.77% | 92.88% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.01% | 90.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.26% | 94.73% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.81% | 95.17% |
CHEMBL5028 | O14672 | ADAM10 | 84.62% | 97.50% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.61% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.44% | 96.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.25% | 91.24% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.96% | 99.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.52% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.91% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 82.75% | 98.75% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.65% | 81.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.21% | 89.00% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.75% | 92.97% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.34% | 95.71% |
CHEMBL2094128 | P24941 | Cyclin-dependent kinase 2/cyclin A | 80.29% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ekebergia capensis |
PubChem | 163196172 |
LOTUS | LTS0214421 |
wikiData | Q105155349 |