[(1S,2S,4aS,5R,6S,8S,8aS)-2-acetyloxy-5-[2-(furan-3-yl)ethyl]-5,8-dihydroxy-1,4a,6-trimethyl-7-oxo-2,3,4,6,8,8a-hexahydronaphthalen-1-yl]methyl acetate
| Internal ID | da3e7175-d70f-4281-bc69-868074d547de |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
| IUPAC Name | [(1S,2S,4aS,5R,6S,8S,8aS)-2-acetyloxy-5-[2-(furan-3-yl)ethyl]-5,8-dihydroxy-1,4a,6-trimethyl-7-oxo-2,3,4,6,8,8a-hexahydronaphthalen-1-yl]methyl acetate |
| SMILES (Canonical) | CC1C(=O)C(C2C(C1(CCC3=COC=C3)O)(CCC(C2(C)COC(=O)C)OC(=O)C)C)O |
| SMILES (Isomeric) | C[C@@H]1C(=O)[C@H]([C@@H]2[C@@]([C@]1(CCC3=COC=C3)O)(CC[C@@H]([C@]2(C)COC(=O)C)OC(=O)C)C)O |
| InChI | InChI=1S/C24H34O8/c1-14-19(27)20(28)21-22(4,13-31-15(2)25)18(32-16(3)26)7-9-23(21,5)24(14,29)10-6-17-8-11-30-12-17/h8,11-12,14,18,20-21,28-29H,6-7,9-10,13H2,1-5H3/t14-,18+,20-,21+,22+,23+,24-/m1/s1 |
| InChI Key | JZHOSKVGCDOWCU-UBIOLHTPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.22536804 g/mol |
| Topological Polar Surface Area (TPSA) | 123.00 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.53% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.95% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.36% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.52% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.66% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.63% | 91.11% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.12% | 93.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.94% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.89% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.16% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.29% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.07% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.03% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.54% | 97.09% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.98% | 97.28% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.22% | 100.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.09% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.24% | 82.69% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.80% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Leonurus sibiricus |
| PubChem | 162895597 |
| LOTUS | LTS0074133 |
| wikiData | Q105137404 |