(2R,3R,4S,5S,6R)-2-[[(1S,2R,3R)-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 5c6b714e-b1c4-44c7-b897-18def08aa739 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(1S,2R,3R)-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C(C(CC3=CC(=C(C(=C23)OC)OC4C(C(C(C(O4)CO)O)O)O)OC)CO)COC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)[C@@H]2[C@H]([C@@H](CC3=CC(=C(C(=C23)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC)CO)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O |
InChI | InChI=1S/C34H48O18/c1-45-17-6-14(7-18(46-2)24(17)38)22-16(12-49-33-29(43)27(41)25(39)20(10-36)50-33)15(9-35)5-13-8-19(47-3)31(32(48-4)23(13)22)52-34-30(44)28(42)26(40)21(11-37)51-34/h6-8,15-16,20-22,25-30,33-44H,5,9-12H2,1-4H3/t15-,16-,20+,21+,22+,25+,26+,27-,28-,29+,30+,33+,34-/m0/s1 |
InChI Key | OFAIGYRIUJNALN-SCKJFOLUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H48O18 |
Molecular Weight | 744.70 g/mol |
Exact Mass | 744.28406468 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | -1.40 |
There are no found synonyms. |
![2D Structure of (2R,3R,4S,5S,6R)-2-[[(1S,2R,3R)-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of (2R,3R,4S,5S,6R)-2-[[(1S,2R,3R)-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/c5564a30-8659-11ee-9b17-93d6896f4244.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.56% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.70% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.79% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.25% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.56% | 99.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.24% | 92.94% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.64% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.38% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.57% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.92% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 86.29% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.73% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.53% | 92.62% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.19% | 89.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.01% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.86% | 96.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.66% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia julibrissin |
PubChem | 15747358 |
LOTUS | LTS0172680 |
wikiData | Q105190758 |