[(3aR,4R,6aR,8S,9aR,9bR)-3,6,9-trimethylidene-2-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate
Internal ID | 68818be0-6d2d-46bf-b061-8017daf80a2f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
IUPAC Name | [(3aR,4R,6aR,8S,9aR,9bR)-3,6,9-trimethylidene-2-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoate |
SMILES (Canonical) | C=C1CC(C2C(C3C1CC(C3=C)OC4C(C(C(C(O4)CO)O)O)O)OC(=O)C2=C)OC(=O)C(CC5=CC=C(C=C5)O)O |
SMILES (Isomeric) | C=C1C[C@H]([C@@H]2[C@@H]([C@@H]3[C@H]1C[C@@H](C3=C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC(=O)C2=C)OC(=O)[C@@H](CC5=CC=C(C=C5)O)O |
InChI | InChI=1S/C30H36O12/c1-12-8-20(39-29(38)18(33)9-15-4-6-16(32)7-5-15)23-14(3)28(37)42-27(23)22-13(2)19(10-17(12)22)40-30-26(36)25(35)24(34)21(11-31)41-30/h4-7,17-27,30-36H,1-3,8-11H2/t17-,18+,19-,20+,21+,22-,23+,24+,25-,26+,27+,30+/m0/s1 |
InChI Key | MAHPANYZARJSAV-AQWLBVFKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H36O12 |
Molecular Weight | 588.60 g/mol |
Exact Mass | 588.22067658 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.72% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.39% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.18% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.98% | 94.45% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.92% | 97.79% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.96% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.65% | 85.14% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.57% | 95.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.14% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.67% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.34% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.30% | 96.09% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 86.29% | 97.53% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.75% | 95.89% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 85.70% | 94.97% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.42% | 94.23% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.98% | 97.25% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.82% | 96.37% |
CHEMBL3891 | P07384 | Calpain 1 | 82.43% | 93.04% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.26% | 85.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.27% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.72% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ixeridium dentatum subsp. dentatum |
Ixeris japonica |
Lapsana communis |
PubChem | 124928645 |
LOTUS | LTS0204186 |
wikiData | Q105160328 |