(1R,11S,13S)-11,16,17-trimethoxy-6,8,12-trioxa-22-azapentacyclo[11.9.0.02,10.05,9.014,19]docosa-2(10),3,5(9),14,16,18-hexaene
Internal ID | 2e18453e-95ba-434d-aaca-5f49c6aa6cf9 |
Taxonomy | Alkaloids and derivatives > Rhoeadine alkaloids |
IUPAC Name | (1R,11S,13S)-11,16,17-trimethoxy-6,8,12-trioxa-22-azapentacyclo[11.9.0.02,10.05,9.014,19]docosa-2(10),3,5(9),14,16,18-hexaene |
SMILES (Canonical) | COC1C2=C(C=CC3=C2OCO3)C4C(O1)C5=CC(=C(C=C5CCN4)OC)OC |
SMILES (Isomeric) | CO[C@@H]1C2=C(C=CC3=C2OCO3)[C@@H]4[C@@H](O1)C5=CC(=C(C=C5CCN4)OC)OC |
InChI | InChI=1S/C21H23NO6/c1-23-15-8-11-6-7-22-18-12-4-5-14-20(27-10-26-14)17(12)21(25-3)28-19(18)13(11)9-16(15)24-2/h4-5,8-9,18-19,21-22H,6-7,10H2,1-3H3/t18-,19+,21+/m1/s1 |
InChI Key | JEUAVYPZVKRQOZ-DYXWJJEUSA-N |
Popularity | 8 references in papers |
Molecular Formula | C21H23NO6 |
Molecular Weight | 385.40 g/mol |
Exact Mass | 385.15253745 g/mol |
Topological Polar Surface Area (TPSA) | 67.40 Ų |
XlogP | 2.10 |
5140-39-6 |
DTXSID301107525 |
(5bR,12bS,14S)-5b,6,7,8,12b,14-Hexahydro-10,11,14-trimethoxy-1,3-dioxolo[7,8][2]benzopyrano[3,4-a][3]benzazepine |
![2D Structure of (1R,11S,13S)-11,16,17-trimethoxy-6,8,12-trioxa-22-azapentacyclo[11.9.0.02,10.05,9.014,19]docosa-2(10),3,5(9),14,16,18-hexaene 2D Structure of (1R,11S,13S)-11,16,17-trimethoxy-6,8,12-trioxa-22-azapentacyclo[11.9.0.02,10.05,9.014,19]docosa-2(10),3,5(9),14,16,18-hexaene](https://plantaedb.com/storage/docs/compounds/2023/07/c3c74ce0-2430-11ee-8359-c980c55b9c25.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.64% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.64% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.03% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.48% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.05% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.01% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.64% | 92.62% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 89.77% | 82.67% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.33% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.37% | 96.77% |
CHEMBL2535 | P11166 | Glucose transporter | 88.05% | 98.75% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.68% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.49% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.41% | 92.94% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.68% | 89.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.42% | 94.00% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.17% | 100.00% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 83.03% | 96.39% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.89% | 94.80% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.29% | 97.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.20% | 94.73% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 81.08% | 95.55% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.35% | 94.03% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.10% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aloe microstigma |
Chrozophora plicata |
Papaver atlanticum |
Papaver orientale |
Papaver pinnatifidum |
Papaver pygmaeum |
Papaver somniferum |
Papaver somniferum subsp. setigerum |
PubChem | 12309624 |
NPASS | NPC135299 |
LOTUS | LTS0252896 |
wikiData | Q104252472 |