[2,3-dihydroxy-5-[[(1R,7R,8S,26R,28S,29R,38R)-1,13,14,15,18,19,20,34,35,39,39-undecahydroxy-2,5,10,23,31-pentaoxo-6,9,24,27,30,40-hexaoxaoctacyclo[34.3.1.04,38.07,26.08,29.011,16.017,22.032,37]tetraconta-3,11,13,15,17,19,21,32,34,36-decaen-28-yl]oxycarbonyl]phenyl] 3,4,5-trihydroxybenzoate
| Internal ID | 3abcebf3-6461-46ca-944f-a7e4fb37aad0 |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | [2,3-dihydroxy-5-[[(1R,7R,8S,26R,28S,29R,38R)-1,13,14,15,18,19,20,34,35,39,39-undecahydroxy-2,5,10,23,31-pentaoxo-6,9,24,27,30,40-hexaoxaoctacyclo[34.3.1.04,38.07,26.08,29.011,16.017,22.032,37]tetraconta-3,11,13,15,17,19,21,32,34,36-decaen-28-yl]oxycarbonyl]phenyl] 3,4,5-trihydroxybenzoate |
| SMILES (Canonical) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C7=C6C8C(=CC(=O)C(C8(O)O)(O7)O)C(=O)O3)O)O)OC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
| SMILES (Isomeric) | C1[C@@H]2[C@@H]3[C@@H]([C@H]([C@@H](O2)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C7=C6[C@@H]8C(=CC(=O)[C@@](C8(O)O)(O7)O)C(=O)O3)O)O)OC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
| InChI | InChI=1S/C48H32O31/c49-16-1-10(2-17(50)29(16)56)40(63)73-22-4-11(3-18(51)30(22)57)41(64)78-46-39-38-36(75-45(68)15-8-24(55)48(71)47(69,70)28(15)27-14(44(67)77-39)7-21(54)33(60)37(27)79-48)23(74-46)9-72-42(65)12-5-19(52)31(58)34(61)25(12)26-13(43(66)76-38)6-20(53)32(59)35(26)62/h1-8,23,28,36,38-39,46,49-54,56-62,69-71H,9H2/t23-,28+,36-,38+,39-,46+,48+/m1/s1 |
| InChI Key | ODVFOVBUUVJYNY-SQPNUZJNSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C48H32O31 |
| Molecular Weight | 1104.70 g/mol |
| Exact Mass | 1104.09275422 g/mol |
| Topological Polar Surface Area (TPSA) | 517.00 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.70% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.75% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.69% | 86.33% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.67% | 83.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.38% | 95.56% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.30% | 95.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.91% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.16% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.46% | 98.95% |
| CHEMBL3194 | P02766 | Transthyretin | 85.64% | 90.71% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.43% | 92.94% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.23% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.37% | 92.62% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.34% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.22% | 99.23% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.06% | 95.78% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.78% | 97.21% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.46% | 98.75% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.05% | 97.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.79% | 96.09% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.76% | 94.42% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.06% | 85.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Macaranga tanarius |
| Spondias mombin |
| PubChem | 162880251 |
| LOTUS | LTS0231631 |
| wikiData | Q105190063 |