5-hydroxy-2-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxychromen-4-one
Internal ID | 5f310e07-068d-4ba7-bf2b-bf8133ebf6cb |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OC5C(C(C(C(O5)CO)O)O)O)C6=C(C=C(C=C6)O)OC7C(C(C(C(O7)CO)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C6=C(C=C(C=C6)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C38H48O26/c1-9-19(43)23(47)27(51)34(56-9)63-38-31(55)26(50)30(54)37(64-38)62-33-22(46)18-13(42)5-11(57-35-28(52)24(48)20(44)16(7-39)60-35)6-15(18)58-32(33)12-3-2-10(41)4-14(12)59-36-29(53)25(49)21(45)17(8-40)61-36/h2-6,9,16-17,19-21,23-31,34-45,47-55H,7-8H2,1H3/t9-,16+,17+,19+,20+,21+,23-,24-,25-,26+,27+,28+,29+,30+,31-,34-,35+,36+,37+,38-/m0/s1 |
InChI Key | YSTMTLXPYDADFN-OCTIIIRFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H48O26 |
Molecular Weight | 920.80 g/mol |
Exact Mass | 920.24338163 g/mol |
Topological Polar Surface Area (TPSA) | 424.00 Ų |
XlogP | -4.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.82% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.25% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.92% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.25% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.27% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.46% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.17% | 96.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.56% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.36% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.14% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.99% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 87.86% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.68% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.37% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.92% | 97.09% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 84.67% | 98.35% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.78% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.46% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.86% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prunus cerasus |
PubChem | 163045405 |
LOTUS | LTS0151526 |
wikiData | Q105360674 |