6-[[8a-(Acetyloxymethyl)-10-benzoyloxy-8,9-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid
Internal ID | 277e467c-0f19-4692-8173-d5feba520c89 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 6-[[8a-(acetyloxymethyl)-10-benzoyloxy-8,9-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC(=O)OCC12C(CC(C(C1O)OC(=O)C3=CC=CC=C3)(C)C)C4=CCC5C6(CCC(C(C6CCC5(C4(CC2O)C)C)(C)C)OC7C(C(C(C(O7)C(=O)O)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C |
SMILES (Isomeric) | CC(=O)OCC12C(CC(C(C1O)OC(=O)C3=CC=CC=C3)(C)C)C4=CCC5C6(CCC(C(C6CCC5(C4(CC2O)C)C)(C)C)OC7C(C(C(C(O7)C(=O)O)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C |
InChI | InChI=1S/C56H82O22/c1-25(58)72-24-56-28(20-51(2,3)45(44(56)67)78-47(70)26-12-10-9-11-13-26)27-14-15-32-53(6)18-17-34(52(4,5)31(53)16-19-54(32,7)55(27,8)21-33(56)60)74-50-43(77-49-39(65)37(63)36(62)30(22-57)73-49)41(40(66)42(76-50)46(68)69)75-48-38(64)35(61)29(59)23-71-48/h9-14,28-45,48-50,57,59-67H,15-24H2,1-8H3,(H,68,69) |
InChI Key | OHHRFKYWKSEADF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C56H82O22 |
Molecular Weight | 1107.20 g/mol |
Exact Mass | 1106.52977424 g/mol |
Topological Polar Surface Area (TPSA) | 348.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
![2D Structure of 6-[[8a-(Acetyloxymethyl)-10-benzoyloxy-8,9-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid 2D Structure of 6-[[8a-(Acetyloxymethyl)-10-benzoyloxy-8,9-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/c2051d50-8550-11ee-bdd9-efe1c8837be6.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.98% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.53% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.32% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.18% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.03% | 90.17% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 93.46% | 91.65% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 92.32% | 89.44% |
CHEMBL5028 | O14672 | ADAM10 | 90.80% | 97.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.75% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.95% | 95.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.60% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.15% | 100.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.00% | 96.21% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.73% | 94.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.65% | 97.09% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.58% | 89.67% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.12% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.09% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.65% | 91.49% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.85% | 93.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.84% | 91.07% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.35% | 97.14% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.23% | 94.08% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.17% | 92.98% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.15% | 99.23% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.96% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Barringtonia acutangula |
PubChem | 85427294 |
LOTUS | LTS0044962 |
wikiData | Q105192084 |