Butyrospermol
Internal ID | 61fb647e-0fb5-48c8-95a7-bba93f4bb586 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CC(CCC=C(C)C)C1CCC2(C1(CCC3C2=CCC4C3(CCC(C4(C)C)O)C)C)C |
SMILES (Isomeric) | CC(CCC=C(C)C)C1CCC2(C1(CCC3C2=CCC4C3(CCC(C4(C)C)O)C)C)C |
InChI | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,12,21-23,25-26,31H,9,11,13-19H2,1-8H3 |
InChI Key | DICCPNLDOZNSML-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C30H50O |
Molecular Weight | 426.70 g/mol |
Exact Mass | 426.386166214 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 9.20 |
3beta-Tirucalla-7,24-dien-3-ol |
472-28-6 |
CHEBI:175449 |
4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.01% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.90% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.17% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.12% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 92.36% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.24% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.19% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.80% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.34% | 95.89% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.64% | 82.69% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.31% | 93.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.07% | 94.75% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.33% | 95.93% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.45% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.20% | 93.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.97% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.96% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.41% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 12302181 |
LOTUS | LTS0213780 |
wikiData | Q104981124 |