Butyric Acid Cinnamyl Ester
Internal ID | 1487a21e-52b1-4bce-85e2-ab06eb757afe |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Styrenes |
IUPAC Name | 3-phenylprop-2-enyl butanoate |
SMILES (Canonical) | CCCC(=O)OCC=CC1=CC=CC=C1 |
SMILES (Isomeric) | CCCC(=O)OCC=CC1=CC=CC=C1 |
InChI | InChI=1S/C13H16O2/c1-2-7-13(14)15-11-6-10-12-8-4-3-5-9-12/h3-6,8-10H,2,7,11H2,1H3 |
InChI Key | YZYPQKZWNXANRB-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C13H16O2 |
Molecular Weight | 204.26 g/mol |
Exact Mass | 204.115029749 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 3.10 |
DTXSID2059277 |
AKOS028108455 |
TRANS-BUTYRIC ACID CINNAMYL ESTER |
C2438 |
FT-0623844 |
FT-0695779 |
D95717 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.39% | 90.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.49% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.19% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.47% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.28% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 90.71% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.55% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.01% | 91.11% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.03% | 91.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.65% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum habrochaites |
PubChem | 7664 |
LOTUS | LTS0042988 |
wikiData | Q105369607 |