Brassidic acid
Internal ID | 204eda70-692a-4145-8d91-d6ded534a705 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Very long-chain fatty acids |
IUPAC Name | (E)-docos-13-enoic acid |
SMILES (Canonical) | CCCCCCCCC=CCCCCCCCCCCCC(=O)O |
SMILES (Isomeric) | CCCCCCCC/C=C/CCCCCCCCCCCC(=O)O |
InChI | InChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H,23,24)/b10-9+ |
InChI Key | DPUOLQHDNGRHBS-MDZDMXLPSA-N |
Popularity | 308 references in papers |
Molecular Formula | C22H42O2 |
Molecular Weight | 338.60 g/mol |
Exact Mass | 338.318480578 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 8.70 |
Atomic LogP (AlogP) | 7.67 |
H-Bond Acceptor | 1 |
H-Bond Donor | 1 |
Rotatable Bonds | 19 |
506-33-2 |
trans-13-Docosenoic acid |
(E)-13-Docosenoic acid |
(E)-Docos-13-enoic acid |
13-Docosenoic acid, (E)- |
13-Docosenoic acid |
trans-brassidic acid |
BRASSIDICACID |
13E-docosenoic acid |
13(E)-Docosenoic acid |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of Brassidic acid 2D Structure of Brassidic acid](https://plantaedb.com/storage/docs/compounds/2023/07/brassidic-acid.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9947 | 99.47% |
Caco-2 | - | 0.5182 | 51.82% |
Blood Brain Barrier | + | 0.8250 | 82.50% |
Human oral bioavailability | - | 0.6143 | 61.43% |
Subcellular localzation | Plasma membrane | 0.5465 | 54.65% |
OATP2B1 inhibitior | - | 0.8520 | 85.20% |
OATP1B1 inhibitior | - | 0.3622 | 36.22% |
OATP1B3 inhibitior | - | 0.5698 | 56.98% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.9000 | 90.00% |
BSEP inhibitior | - | 0.5855 | 58.55% |
P-glycoprotein inhibitior | - | 0.7459 | 74.59% |
P-glycoprotein substrate | - | 0.9649 | 96.49% |
CYP3A4 substrate | - | 0.6902 | 69.02% |
CYP2C9 substrate | + | 0.6276 | 62.76% |
CYP2D6 substrate | - | 0.8766 | 87.66% |
CYP3A4 inhibition | - | 0.9295 | 92.95% |
CYP2C9 inhibition | - | 0.8972 | 89.72% |
CYP2C19 inhibition | - | 0.9467 | 94.67% |
CYP2D6 inhibition | - | 0.9545 | 95.45% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.9384 | 93.84% |
CYP inhibitory promiscuity | - | 0.9349 | 93.49% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.7035 | 70.35% |
Carcinogenicity (trinary) | Non-required | 0.7021 | 70.21% |
Eye corrosion | + | 0.9611 | 96.11% |
Eye irritation | + | 0.9501 | 95.01% |
Skin irritation | + | 0.8622 | 86.22% |
Skin corrosion | + | 0.6450 | 64.50% |
Ames mutagenesis | - | 0.9900 | 99.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4361 | 43.61% |
Micronuclear | - | 1.0000 | 100.00% |
Hepatotoxicity | - | 0.7625 | 76.25% |
skin sensitisation | + | 0.8676 | 86.76% |
Respiratory toxicity | - | 0.7111 | 71.11% |
Reproductive toxicity | - | 0.7866 | 78.66% |
Mitochondrial toxicity | + | 0.5625 | 56.25% |
Nephrotoxicity | - | 0.7161 | 71.61% |
Acute Oral Toxicity (c) | IV | 0.8289 | 82.89% |
Estrogen receptor binding | + | 0.5916 | 59.16% |
Androgen receptor binding | - | 0.8205 | 82.05% |
Thyroid receptor binding | + | 0.6098 | 60.98% |
Glucocorticoid receptor binding | - | 0.6622 | 66.22% |
Aromatase binding | - | 0.7186 | 71.86% |
PPAR gamma | + | 0.8707 | 87.07% |
Honey bee toxicity | - | 0.9960 | 99.60% |
Biodegradation | + | 0.8250 | 82.50% |
Crustacea aquatic toxicity | + | 0.8900 | 89.00% |
Fish aquatic toxicity | + | 0.9649 | 96.49% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha |
600 nM |
IC50 |
via Super-PRED
|
CHEMBL2219 | P35236 | Protein-tyrosine phosphatase LC-PTP |
801 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.97% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 95.56% | 98.95% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.16% | 92.08% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.14% | 89.63% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 93.36% | 97.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.93% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.65% | 90.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.24% | 96.95% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.84% | 85.94% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.86% | 97.29% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.06% | 96.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.12% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cynomorium coccineum subsp. songaricum |
Fagopyrum esculentum |
Terminalia chebula |
PubChem | 5282772 |
NPASS | NPC13059 |
LOTUS | LTS0109046 |
wikiData | Q10395578 |