Bornyl cinnamate
Internal ID | 0a523990-90b5-4044-ba5c-634d8edd9987 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-phenylprop-2-enoate |
SMILES (Canonical) | CC1(C2CCC1(C(C2)OC(=O)C=CC3=CC=CC=C3)C)C |
SMILES (Isomeric) | CC1(C2CCC1(C(C2)OC(=O)C=CC3=CC=CC=C3)C)C |
InChI | InChI=1S/C19H24O2/c1-18(2)15-11-12-19(18,3)16(13-15)21-17(20)10-9-14-7-5-4-6-8-14/h4-10,15-16H,11-13H2,1-3H3 |
InChI Key | ACTRLDZRLKIJEH-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C19H24O2 |
Molecular Weight | 284.40 g/mol |
Exact Mass | 284.177630004 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 5.20 |
6330-67-2 |
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3-phenylprop-2-enoate |
BORNYLCINNAMATE |
NCIOpen2_003407 |
SCHEMBL4237838 |
CHEBI:157711 |
1,7,7-trimethylbicyclo[2.2.1]hept-2-yl 3-phenylacrylate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.18% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.90% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.49% | 91.11% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 95.29% | 94.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.03% | 86.33% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 94.96% | 94.23% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 94.09% | 94.08% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.50% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.00% | 96.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.26% | 90.17% |
CHEMBL5028 | O14672 | ADAM10 | 86.96% | 97.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.49% | 95.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.49% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Montanoa tomentosa |
Piper methysticum |
Verbesina luetzelburgii |
PubChem | 583021 |
LOTUS | LTS0037127 |
wikiData | Q104909306 |