1-methoxy-9-[(1-methoxy-9H-carbazol-3-yl)methyl]-3-methylcarbazole
| Internal ID | f399ed4a-412c-4b70-9932-1240ebd25f30 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 1-methoxy-9-[(1-methoxy-9H-carbazol-3-yl)methyl]-3-methylcarbazole |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)OC)N(C3=CC=CC=C32)CC4=CC5=C(C(=C4)OC)NC6=CC=CC=C65 |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1)OC)N(C3=CC=CC=C32)CC4=CC5=C(C(=C4)OC)NC6=CC=CC=C65 |
| InChI | InChI=1S/C28H24N2O2/c1-17-12-22-20-9-5-7-11-24(20)30(28(22)26(13-17)32-3)16-18-14-21-19-8-4-6-10-23(19)29-27(21)25(15-18)31-2/h4-15,29H,16H2,1-3H3 |
| InChI Key | BWIDIGNNLPIYNM-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.183778013 g/mol |
| Topological Polar Surface Area (TPSA) | 39.20 Ų |
| XlogP | 6.70 |
| CHEMBL496078 |
| NSC-654292 |
| NCI60_018856 |
![2D Structure of 1-methoxy-9-[(1-methoxy-9H-carbazol-3-yl)methyl]-3-methylcarbazole](https://plantaedb.com/storage/docs/compounds/2023/07/bismurrayafoline-a.jpg "2D Structure of 1-methoxy-9-[(1-methoxy-9H-carbazol-3-yl)methyl]-3-methylcarbazole")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.18% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.24% | 98.95% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 95.13% | 85.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.54% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.44% | 95.56% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 94.31% | 89.44% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 94.30% | 92.98% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.20% | 93.99% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 92.90% | 98.59% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 92.56% | 97.31% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 92.56% | 91.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.61% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.55% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.79% | 98.75% |
| CHEMBL228 | P31645 | Serotonin transporter | 88.73% | 95.51% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.85% | 95.17% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 84.54% | 87.45% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 84.37% | 92.67% |
| CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | 83.81% | 85.40% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.50% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.68% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.41% | 94.00% |
| CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 80.34% | 97.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bergera euchrestifolia |
| PubChem | 375158 |
| NPASS | NPC94157 |
| ChEMBL | CHEMBL496078 |
| LOTUS | LTS0200633 |
| wikiData | Q104947259 |