Bis(3-ethylpiperidin-1-yl)methanone
| Internal ID | d8d7bec1-c4b2-4242-8ab3-9cc59ecaa070 |
| Taxonomy | Organoheterocyclic compounds > Piperidines > Piperidinecarboxylic acids and derivatives > Piperidinecarboxamides |
| IUPAC Name | bis(3-ethylpiperidin-1-yl)methanone |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H28N2O/c1-3-13-7-5-9-16(11-13)15(18)17-10-6-8-14(4-2)12-17/h13-14H,3-12H2,1-2H3 |
| InChI Key | PEQRUDXKHIKUSC-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.220163521 g/mol |
| Topological Polar Surface Area (TPSA) | 23.60 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.21% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.62% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.22% | 97.25% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 88.31% | 98.77% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 87.97% | 98.33% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.63% | 96.61% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 86.03% | 93.90% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.84% | 98.10% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.61% | 93.04% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.48% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.64% | 97.09% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.43% | 90.24% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.97% | 94.33% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.87% | 97.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.92% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.23% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rhazya stricta |
| PubChem | 86260418 |
| LOTUS | LTS0082694 |
| wikiData | Q105207265 |