2-[[15-Butan-2-yl-21-[3-(diaminomethylideneamino)propyl]-12-(2-methylpropyl)-10,13,16,19,22,25-hexaoxo-9-[(5-oxopyrrolidine-2-carbonyl)amino]-8-propan-2-yl-2,11,14,17,20,23,26,30,32-nonazapentacyclo[16.14.2.13,7.129,32.04,33]hexatriaconta-1(33),3,5,7(36),29(35),30-hexaene-27-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid
Internal ID | b2c05249-a04c-431b-91f6-edb687ffb41b |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
IUPAC Name | 2-[[15-butan-2-yl-21-[3-(diaminomethylideneamino)propyl]-12-(2-methylpropyl)-10,13,16,19,22,25-hexaoxo-9-[(5-oxopyrrolidine-2-carbonyl)amino]-8-propan-2-yl-2,11,14,17,20,23,26,30,32-nonazapentacyclo[16.14.2.13,7.129,32.04,33]hexatriaconta-1(33),3,5,7(36),29(35),30-hexaene-27-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
SMILES (Canonical) | CCC(C)C1C(=O)NC2CC3=C(NC4=C3C=CC(=C4)C(C(C(=O)NC(C(=O)N1)CC(C)C)NC(=O)C5CCC(=O)N5)C(C)C)N6C=C(CC(NC(=O)CNC(=O)C(NC2=O)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O)N=C6 |
SMILES (Isomeric) | CCC(C)C1C(=O)NC2CC3=C(NC4=C3C=CC(=C4)C(C(C(=O)NC(C(=O)N1)CC(C)C)NC(=O)C5CCC(=O)N5)C(C)C)N6C=C(CC(NC(=O)CNC(=O)C(NC2=O)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O)N=C6 |
InChI | InChI=1S/C54H80N18O11/c1-7-27(6)42-50(80)69-38-21-31-30-13-12-28(41(26(4)5)43(71-46(76)33-14-15-39(73)63-33)51(81)68-36(18-25(2)3)49(79)70-42)19-35(30)65-44(31)72-23-29(62-24-72)20-37(47(77)67-34(52(82)83)11-9-17-60-54(57)58)64-40(74)22-61-45(75)32(66-48(38)78)10-8-16-59-53(55)56/h12-13,19,23-27,32-34,36-38,41-43,65H,7-11,14-18,20-22H2,1-6H3,(H,61,75)(H,63,73)(H,64,74)(H,66,78)(H,67,77)(H,68,81)(H,69,80)(H,70,79)(H,71,76)(H,82,83)(H4,55,56,59)(H4,57,58,60) |
InChI Key | ZHZMPGHVJPUJIR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C54H80N18O11 |
Molecular Weight | 1157.30 g/mol |
Exact Mass | 1156.62539544 g/mol |
Topological Polar Surface Area (TPSA) | 462.00 Ų |
XlogP | -0.70 |
Atomic LogP (AlogP) | -2.72 |
H-Bond Acceptor | 14 |
H-Bond Donor | 15 |
Rotatable Bonds | 18 |
There are no found synonyms. |
![2D Structure of 2-[[15-Butan-2-yl-21-[3-(diaminomethylideneamino)propyl]-12-(2-methylpropyl)-10,13,16,19,22,25-hexaoxo-9-[(5-oxopyrrolidine-2-carbonyl)amino]-8-propan-2-yl-2,11,14,17,20,23,26,30,32-nonazapentacyclo[16.14.2.13,7.129,32.04,33]hexatriaconta-1(33),3,5,7(36),29(35),30-hexaene-27-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid 2D Structure of 2-[[15-Butan-2-yl-21-[3-(diaminomethylideneamino)propyl]-12-(2-methylpropyl)-10,13,16,19,22,25-hexaoxo-9-[(5-oxopyrrolidine-2-carbonyl)amino]-8-propan-2-yl-2,11,14,17,20,23,26,30,32-nonazapentacyclo[16.14.2.13,7.129,32.04,33]hexatriaconta-1(33),3,5,7(36),29(35),30-hexaene-27-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/bf8c4e90-7f68-11ee-b8b6-c54026a9829c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9425 | 94.25% |
Caco-2 | - | 0.8624 | 86.24% |
Blood Brain Barrier | - | 0.6500 | 65.00% |
Human oral bioavailability | - | 0.6714 | 67.14% |
Subcellular localzation | Mitochondria | 0.3828 | 38.28% |
OATP2B1 inhibitior | - | 0.8588 | 85.88% |
OATP1B1 inhibitior | + | 0.8100 | 81.00% |
OATP1B3 inhibitior | + | 0.9393 | 93.93% |
MATE1 inhibitior | - | 0.7209 | 72.09% |
OCT2 inhibitior | - | 0.6750 | 67.50% |
BSEP inhibitior | + | 0.9708 | 97.08% |
P-glycoprotein inhibitior | + | 0.7451 | 74.51% |
P-glycoprotein substrate | + | 0.8762 | 87.62% |
CYP3A4 substrate | + | 0.7459 | 74.59% |
CYP2C9 substrate | - | 0.5968 | 59.68% |
CYP2D6 substrate | - | 0.8534 | 85.34% |
CYP3A4 inhibition | - | 0.9483 | 94.83% |
CYP2C9 inhibition | - | 0.8149 | 81.49% |
CYP2C19 inhibition | - | 0.7781 | 77.81% |
CYP2D6 inhibition | - | 0.8896 | 88.96% |
CYP1A2 inhibition | - | 0.8113 | 81.13% |
CYP2C8 inhibition | + | 0.8359 | 83.59% |
CYP inhibitory promiscuity | - | 0.9570 | 95.70% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8700 | 87.00% |
Carcinogenicity (trinary) | Non-required | 0.6109 | 61.09% |
Eye corrosion | - | 0.9854 | 98.54% |
Eye irritation | - | 0.8978 | 89.78% |
Skin irritation | - | 0.7721 | 77.21% |
Skin corrosion | - | 0.9290 | 92.90% |
Ames mutagenesis | - | 0.6700 | 67.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6539 | 65.39% |
Micronuclear | + | 0.8800 | 88.00% |
Hepatotoxicity | + | 0.5803 | 58.03% |
skin sensitisation | - | 0.8491 | 84.91% |
Respiratory toxicity | + | 0.8000 | 80.00% |
Reproductive toxicity | + | 0.9333 | 93.33% |
Mitochondrial toxicity | + | 0.8500 | 85.00% |
Nephrotoxicity | - | 0.7644 | 76.44% |
Acute Oral Toxicity (c) | III | 0.5509 | 55.09% |
Estrogen receptor binding | + | 0.7101 | 71.01% |
Androgen receptor binding | + | 0.7270 | 72.70% |
Thyroid receptor binding | + | 0.6431 | 64.31% |
Glucocorticoid receptor binding | + | 0.6294 | 62.94% |
Aromatase binding | + | 0.7192 | 71.92% |
PPAR gamma | + | 0.7443 | 74.43% |
Honey bee toxicity | - | 0.6706 | 67.06% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | - | 0.6100 | 61.00% |
Fish aquatic toxicity | + | 0.8509 | 85.09% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.99% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.87% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 99.69% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.60% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.97% | 91.11% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 98.07% | 90.24% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.82% | 97.09% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.47% | 90.08% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.45% | 99.17% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.31% | 93.10% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.00% | 93.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.78% | 90.71% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 95.67% | 88.56% |
CHEMBL2535 | P11166 | Glucose transporter | 94.97% | 98.75% |
CHEMBL220 | P22303 | Acetylcholinesterase | 94.64% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.27% | 94.75% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 93.50% | 98.59% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.79% | 95.89% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 92.55% | 97.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.52% | 96.00% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 90.40% | 97.64% |
CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 90.23% | 88.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.15% | 96.47% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.77% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.45% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.96% | 86.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.62% | 100.00% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 87.32% | 99.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.61% | 89.00% |
CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 86.51% | 94.36% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.56% | 85.14% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 85.39% | 87.16% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 85.39% | 80.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.79% | 99.23% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.60% | 95.58% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.92% | 93.00% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 83.91% | 97.00% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.96% | 82.86% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.39% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.35% | 97.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.11% | 90.17% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.27% | 98.33% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 81.12% | 85.83% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.97% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.94% | 97.14% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.77% | 96.90% |
CHEMBL2443 | P49862 | Kallikrein 7 | 80.39% | 94.00% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.24% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Celosia argentea |
PubChem | 73986001 |
LOTUS | LTS0232644 |
wikiData | Q105376171 |