beta-Norcoralydine
Internal ID | 411bfc09-59c5-42f3-86cb-cc7bf9020baa |
Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
IUPAC Name | 2,3,10,11-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
SMILES (Canonical) | COC1=C(C=C2C3CC4=CC(=C(C=C4CN3CCC2=C1)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C=C2C3CC4=CC(=C(C=C4CN3CCC2=C1)OC)OC)OC |
InChI | InChI=1S/C21H25NO4/c1-23-18-8-13-5-6-22-12-15-10-20(25-3)19(24-2)9-14(15)7-17(22)16(13)11-21(18)26-4/h8-11,17H,5-7,12H2,1-4H3 |
InChI Key | YOAUKNYXWBTMMF-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C21H25NO4 |
Molecular Weight | 355.40 g/mol |
Exact Mass | 355.17835828 g/mol |
Topological Polar Surface Area (TPSA) | 40.20 Ų |
XlogP | 3.20 |
d-Xylopinine |
(+-)-Xylopinine |
R-(+)-Xylopinine |
(+-)-Norcoralydine |
l-Xylopinine |
(+)-Xylopinine |
NSC 241040 |
MLS002638117 |
Berbine, 2,3,10,11-tetramethoxy-, (+-)- |
NSC10105 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2362978 | P43351 | DNA repair protein RAD52 homolog |
4490 nM |
AC50 |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.90% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 90.71% | 95.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.56% | 92.94% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.71% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 89.27% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.89% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.23% | 86.33% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 87.11% | 96.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.01% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.99% | 89.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.73% | 91.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.70% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.69% | 85.14% |
CHEMBL5747 | Q92793 | CREB-binding protein | 85.12% | 95.12% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.56% | 90.24% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.43% | 82.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.66% | 94.45% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.57% | 91.03% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.08% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.72% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.33% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corydalis ternata |
Corydalis turtschaninovii |
Corydalis yanhusuo |
Stephania pierrei |
Stephania suberosa |
Xylopia discreta |
PubChem | 10653 |
NPASS | NPC128019 |
ChEMBL | CHEMBL2357282 |
LOTUS | LTS0273788 |
wikiData | Q82976944 |