beta-Chacotriosyllilagen
Internal ID | f0aeffd3-b2b5-47cd-99db-0e7d6b897c1e |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4-hydroxy-2-(hydroxymethyl)-6-(15-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CC(C(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)O)C)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CC(C(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)O)C)C)C)OC1 |
InChI | InChI=1S/C45H72O17/c1-18-9-12-45(55-17-18)19(2)30-28(62-45)14-25-23-8-7-22-13-27(26(47)15-44(22,6)24(23)10-11-43(25,30)5)58-42-39(61-41-36(53)34(51)32(49)21(4)57-41)37(54)38(29(16-46)59-42)60-40-35(52)33(50)31(48)20(3)56-40/h7,18-21,23-42,46-54H,8-17H2,1-6H3 |
InChI Key | KDRHBRBDBYKMFS-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C45H72O17 |
Molecular Weight | 885.00 g/mol |
Exact Mass | 884.47695082 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | 0.40 |
beta-Chacotriosyllilagen |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.72% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.32% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.98% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.03% | 97.09% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.86% | 95.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.68% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.35% | 96.61% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.31% | 89.05% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.74% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.93% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.90% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.90% | 86.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.96% | 95.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.91% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.81% | 94.45% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 86.11% | 94.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.32% | 94.73% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.75% | 92.86% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.43% | 100.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.75% | 97.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.47% | 94.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.09% | 91.24% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.91% | 93.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.44% | 97.25% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.09% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium tuberosum |
PubChem | 131751781 |
LOTUS | LTS0220364 |
wikiData | Q105139347 |