Benzyl alcohol, cinnamate
| Internal ID | eb70b407-4952-4b5d-97ab-971cb8534bca |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
| IUPAC Name | benzyl (Z)-3-phenylprop-2-enoate |
| SMILES (Canonical) | C1=CC=C(C=C1)COC(=O)C=CC2=CC=CC=C2 |
| SMILES (Isomeric) | C1=CC=C(C=C1)COC(=O)/C=C\C2=CC=CC=C2 |
| InChI | InChI=1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11- |
| InChI Key | NGHOLYJTSCBCGC-QXMHVHEDSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.099379685 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 3.80 |
| Benzyl cinnamate, (Z)- |
| 68BV7JX3NX |
| Benzyl alcohol, cinnamate |
| UNII-68BV7JX3NX |
| Benzyl alcohol cinnamic ester |
| Benzylcinnamate |
| Phenylmethyl (2Z)-3-phenyl-2-propenoate |
| 2-Propenoic acid, 3-phenyl-, phenylmethyl ester, (2Z)- |
| benzyl (Z)-3-phenylprop-2-enoate |
| WLN: R1U1VO1R |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293235 | P02545 | Prelamin-A/C |
35.5 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.60% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.15% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.34% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.78% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.23% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.71% | 98.95% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.69% | 91.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.15% | 96.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.73% | 94.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.83% | 95.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.81% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.84% | 94.73% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.19% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cornus officinalis |
| Myroxylon balsamum |
| Polygala senega |
| Styrax benzoin |
| Styrax tonkinensis |
| PubChem | 15558051 |
| NPASS | NPC115295 |
| LOTUS | LTS0194483 |
| wikiData | Q76506726 |