Benzene, 1,1'-(1,2-ethenediyl)bis-
| Internal ID | 0a491511-e6b7-4743-b74f-fb125a94e8f4 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | stilbene |
| SMILES (Canonical) | C1=CC=C(C=C1)C=CC2=CC=CC=C2 |
| SMILES (Isomeric) | C1=CC=C(C=C1)C=CC2=CC=CC=C2 |
| InChI | InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H |
| InChI Key | PJANXHGTPQOBST-UHFFFAOYSA-N |
| Popularity | 1,109 references in papers |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.093900383 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.80 |
| Benzene, 1,1'-(1,2-ethenediyl)bis- |
| Stilben |
| 1,2-Diphenylethene |
| .alpha.,.beta.-Diphenylethylene |
| phenylstyrene |
| MFCD00004788 |
| MFCD00064300 |
| 1,2-diphenyl-ethylene |
| 1,2 Diphenyl Ethylene |
| DTXSID6060424 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 94.11% | 94.62% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.43% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.08% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.07% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.09% | 86.33% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 87.03% | 94.08% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.59% | 90.17% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.89% | 93.99% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 81.30% | 92.51% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.17% | 94.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alnus firma |
| Alnus sieboldiana |
| Petiveria alliacea |
| Pinus taeda |
| PubChem | 11502 |
| LOTUS | LTS0168572 |
| wikiData | Q26990366 |