[(3S,4aR,6aR,6bS,8aS,11S,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,14,14a-dodecahydro-1H-picen-3-yl] acetate
Internal ID | b5596f3d-8308-4338-85b8-d9be00c6c486 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(3S,4aR,6aR,6bS,8aS,11S,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,14,14a-dodecahydro-1H-picen-3-yl] acetate |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC(=O)C)C)C)C2=C1C)C)CO |
SMILES (Isomeric) | C[C@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OC(=O)C)C)C)C2=C1C)C)CO |
InChI | InChI=1S/C32H50O3/c1-20-11-16-32(19-33)18-17-30(7)23(27(32)21(20)2)9-10-25-29(6)14-13-26(35-22(3)34)28(4,5)24(29)12-15-31(25,30)8/h9,20,24-26,33H,10-19H2,1-8H3/t20-,24-,25+,26-,29-,30+,31+,32+/m0/s1 |
InChI Key | BFOZVRYBLMMLLG-QUVQJALSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H50O3 |
Molecular Weight | 482.70 g/mol |
Exact Mass | 482.37599545 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 7.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.93% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.21% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.88% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.29% | 94.75% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.72% | 82.69% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.90% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.06% | 95.56% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.48% | 97.79% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.69% | 100.00% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.67% | 85.49% |
CHEMBL5028 | O14672 | ADAM10 | 81.46% | 97.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.45% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.38% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.91% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.89% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.70% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.22% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.19% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Symplocos racemosa |
PubChem | 101586329 |
LOTUS | LTS0179184 |
wikiData | Q104934666 |