2-[3-[10-(3,3-Dimethyloxiran-2-yl)-10-hydroxy-4,8-dimethyldeca-3,7-dienyl]-2-(3-hydroxypropyl)-3,4-dimethylcyclohexylidene]propanal
| Internal ID | 7c8adb09-6591-46b5-89bc-4d05567f6e4e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 2-[3-[10-(3,3-dimethyloxiran-2-yl)-10-hydroxy-4,8-dimethyldeca-3,7-dienyl]-2-(3-hydroxypropyl)-3,4-dimethylcyclohexylidene]propanal |
| SMILES (Canonical) | CC1CCC(=C(C)C=O)C(C1(C)CCC=C(C)CCC=C(C)CC(C2C(O2)(C)C)O)CCCO |
| SMILES (Isomeric) | CC1CCC(=C(C)C=O)C(C1(C)CCC=C(C)CCC=C(C)CC(C2C(O2)(C)C)O)CCCO |
| InChI | InChI=1S/C30H50O4/c1-21(11-8-12-22(2)19-27(33)28-29(5,6)34-28)13-9-17-30(7)24(4)15-16-25(23(3)20-32)26(30)14-10-18-31/h12-13,20,24,26-28,31,33H,8-11,14-19H2,1-7H3 |
| InChI Key | SZBACOZLVMVKCH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.37091007 g/mol |
| Topological Polar Surface Area (TPSA) | 70.10 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
![2D Structure of 2-[3-[10-(3,3-Dimethyloxiran-2-yl)-10-hydroxy-4,8-dimethyldeca-3,7-dienyl]-2-(3-hydroxypropyl)-3,4-dimethylcyclohexylidene]propanal](https://plantaedb.com/storage/docs/compounds/2023/11/bd585ee0-8310-11ee-b2be-41eaa7c85c43.jpg "2D Structure of 2-[3-[10-(3,3-Dimethyloxiran-2-yl)-10-hydroxy-4,8-dimethyldeca-3,7-dienyl]-2-(3-hydroxypropyl)-3,4-dimethylcyclohexylidene]propanal")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.08% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.34% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.55% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.30% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.70% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.35% | 95.50% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 86.96% | 92.51% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.44% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.89% | 94.45% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.70% | 93.18% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.43% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.28% | 99.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.38% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.37% | 93.10% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.85% | 98.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.84% | 97.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.51% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.80% | 89.00% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.50% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.10% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Iris cristata |
| PubChem | 162938231 |
| LOTUS | LTS0220258 |
| wikiData | Q105263933 |