[(2S,3S,4R,5R,6S)-4,5-diacetyloxy-6-[(2S,3R,4S,5S)-2-[(1S,2S,3'R,4S,4'S,6S,7S,8R,9S,12S,13R,14R,16R)-3'-[(2S,3R,4R,6R)-3,4-dihydroxy-6-methyl-5-oxooxan-2-yl]oxy-4',16-dihydroxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-2-methyloxan-3-yl] acetate
Internal ID | b899f888-07a1-4897-8823-ee3e48802e52 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | [(2S,3S,4R,5R,6S)-4,5-diacetyloxy-6-[(2S,3R,4S,5S)-2-[(1S,2S,3'R,4S,4'S,6S,7S,8R,9S,12S,13R,14R,16R)-3'-[(2S,3R,4R,6R)-3,4-dihydroxy-6-methyl-5-oxooxan-2-yl]oxy-4',16-dihydroxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-2-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(CO6)O)O)OC7C(C(C(C(O7)C)OC(=O)C)OC(=O)C)OC(=O)C)C)C)OC18C(C(C(=C)CO8)O)OC9C(C(C(=O)C(O9)C)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4([C@@H](C[C@@H](C5)O)O[C@H]6[C@@H]([C@H]([C@H](CO6)O)O)O[C@H]7[C@@H]([C@@H]([C@H]([C@@H](O7)C)OC(=O)C)OC(=O)C)OC(=O)C)C)C)O[C@]18[C@@H]([C@H](C(=C)CO8)O)O[C@H]9[C@@H]([C@H](C(=O)[C@H](O9)C)O)O |
InChI | InChI=1S/C50H72O21/c1-19-17-62-50(44(35(19)56)70-45-39(60)38(59)36(57)21(3)63-45)20(2)34-32(71-50)16-30-28-11-10-26-14-27(54)15-33(49(26,9)29(28)12-13-48(30,34)8)68-46-41(37(58)31(55)18-61-46)69-47-43(67-25(7)53)42(66-24(6)52)40(22(4)64-47)65-23(5)51/h10,20-22,27-35,37-47,54-56,58-60H,1,11-18H2,2-9H3/t20-,21+,22-,27+,28+,29-,30-,31-,32-,33+,34-,35-,37-,38-,39+,40-,41+,42+,43+,44+,45-,46-,47-,48-,49-,50-/m0/s1 |
InChI Key | JSWNYMYOFCTRDA-HJVHPHBZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H72O21 |
Molecular Weight | 1009.10 g/mol |
Exact Mass | 1008.45660930 g/mol |
Topological Polar Surface Area (TPSA) | 291.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
![2D Structure of [(2S,3S,4R,5R,6S)-4,5-diacetyloxy-6-[(2S,3R,4S,5S)-2-[(1S,2S,3'R,4S,4'S,6S,7S,8R,9S,12S,13R,14R,16R)-3'-[(2S,3R,4R,6R)-3,4-dihydroxy-6-methyl-5-oxooxan-2-yl]oxy-4',16-dihydroxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-2-methyloxan-3-yl] acetate 2D Structure of [(2S,3S,4R,5R,6S)-4,5-diacetyloxy-6-[(2S,3R,4S,5S)-2-[(1S,2S,3'R,4S,4'S,6S,7S,8R,9S,12S,13R,14R,16R)-3'-[(2S,3R,4R,6R)-3,4-dihydroxy-6-methyl-5-oxooxan-2-yl]oxy-4',16-dihydroxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-2-methyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/bce52e20-867c-11ee-b043-df1c171f5aa1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.61% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.52% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.57% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.24% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.00% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.75% | 94.45% |
CHEMBL204 | P00734 | Thrombin | 92.28% | 96.01% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.92% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.87% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.99% | 85.14% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 90.88% | 94.50% |
CHEMBL2581 | P07339 | Cathepsin D | 90.19% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.00% | 91.19% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.72% | 92.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.55% | 94.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.07% | 95.93% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.85% | 97.28% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.05% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.90% | 97.09% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.84% | 92.88% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.78% | 91.07% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.94% | 94.73% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.49% | 96.43% |
CHEMBL5028 | O14672 | ADAM10 | 81.43% | 97.50% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.19% | 95.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.90% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ruscus aculeatus |
PubChem | 162847192 |
LOTUS | LTS0101120 |
wikiData | Q105134622 |