8-(4-Hydroxy-6-methylhept-5-en-2-yl)-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-ol
Internal ID | a59cbc43-0596-492d-ad75-a37524659844 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | 8-(4-hydroxy-6-methylhept-5-en-2-yl)-5,9,17,17-tetramethyl-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-ol |
SMILES (Canonical) | CC(CC(C=C(C)C)O)C1CCC2(C1(CCC34C2C=CC5(C3CCC(C5(C)C)O)OC4)C)C |
SMILES (Isomeric) | CC(CC(C=C(C)C)O)C1CCC2(C1(CCC34C2C=CC5(C3CCC(C5(C)C)O)OC4)C)C |
InChI | InChI=1S/C30H48O3/c1-19(2)16-21(31)17-20(3)22-10-12-28(7)23-11-13-30-24(8-9-25(32)26(30,4)5)29(23,18-33-30)15-14-27(22,28)6/h11,13,16,20-25,31-32H,8-10,12,14-15,17-18H2,1-7H3 |
InChI Key | BZKMSMPQWDQSDS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O3 |
Molecular Weight | 456.70 g/mol |
Exact Mass | 456.36034539 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 6.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.85% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.60% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.90% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.88% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.59% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.64% | 95.89% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 89.30% | 95.58% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.06% | 100.00% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 87.32% | 95.34% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.18% | 90.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.47% | 100.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.03% | 89.05% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.62% | 85.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.09% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.89% | 97.09% |
CHEMBL268 | P43235 | Cathepsin K | 84.76% | 96.85% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 84.45% | 87.16% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.43% | 98.46% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.87% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.82% | 100.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.19% | 89.50% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.54% | 97.50% |
CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 80.30% | 100.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.26% | 94.78% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.19% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica balsamina |
Momordica charantia |
PubChem | 75225001 |
LOTUS | LTS0103100 |
wikiData | Q104950510 |