Balsaminol D
Internal ID | f3749c60-212d-4347-9a66-27b902dd0154 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Oxosteroids |
IUPAC Name | (3S,4S,8R,9S,10S,13R,14S,17R)-3-hydroxy-4-(hydroxymethyl)-4,9,13,14-tetramethyl-17-[(2R)-4-oxopentan-2-yl]-1,2,3,8,10,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-7-one |
SMILES (Canonical) | CC(CC(=O)C)C1CCC2(C1(CCC3(C2C(=O)C=C4C3CCC(C4(C)CO)O)C)C)C |
SMILES (Isomeric) | C[C@H](CC(=O)C)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2C(=O)C=C4[C@H]3CC[C@@H]([C@]4(C)CO)O)C)C)C |
InChI | InChI=1S/C27H42O4/c1-16(13-17(2)29)18-9-10-27(6)23-21(30)14-20-19(7-8-22(31)25(20,4)15-28)24(23,3)11-12-26(18,27)5/h14,16,18-19,22-23,28,31H,7-13,15H2,1-6H3/t16-,18-,19-,22+,23-,24+,25-,26-,27+/m1/s1 |
InChI Key | NBZHVWXCQLFQNW-ATYSFEEYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C27H42O4 |
Molecular Weight | 430.60 g/mol |
Exact Mass | 430.30830982 g/mol |
Topological Polar Surface Area (TPSA) | 74.60 Ų |
XlogP | 4.60 |
CHEMBL1254848 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.23% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.23% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.32% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.93% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.99% | 94.45% |
CHEMBL299 | P17252 | Protein kinase C alpha | 91.15% | 98.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.03% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.30% | 93.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.87% | 94.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.06% | 95.89% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.59% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.23% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.13% | 96.77% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.72% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.46% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.38% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.18% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica balsamina |
PubChem | 52947048 |
LOTUS | LTS0174818 |
wikiData | Q105177083 |