(1S,2S,3R,6R,7R,10S)-2,7-dihydroxy-3,7-dimethyl-11-methylidene-13-oxatricyclo[8.3.0.03,6]tridecan-12-one
| Internal ID | 4d540c24-1ebb-4ab1-b700-375cff0e88d9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
| IUPAC Name | (1S,2S,3R,6R,7R,10S)-2,7-dihydroxy-3,7-dimethyl-11-methylidene-13-oxatricyclo[8.3.0.03,6]tridecan-12-one |
| SMILES (Canonical) | CC12CCC1C(CCC3C(C2O)OC(=O)C3=C)(C)O |
| SMILES (Isomeric) | C[C@@]12CC[C@H]1[C@](CC[C@@H]3[C@@H]([C@H]2O)OC(=O)C3=C)(C)O |
| InChI | InChI=1S/C15H22O4/c1-8-9-4-7-15(3,18)10-5-6-14(10,2)12(16)11(9)19-13(8)17/h9-12,16,18H,1,4-7H2,2-3H3/t9-,10+,11-,12+,14+,15+/m0/s1 |
| InChI Key | BIURAVISNLIZHC-NMAMFNKQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.08% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.70% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.00% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.65% | 100.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.43% | 97.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.18% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.50% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.42% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.04% | 98.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.09% | 82.69% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.77% | 93.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.46% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Magnolia champaca |
| PubChem | 42601483 |
| LOTUS | LTS0126317 |
| wikiData | Q104936799 |