[(2S,3S,4R,5R)-2-[(2R,3S,4S,5S,6R)-3,5-diacetyloxy-6-(acetyloxymethyl)-4-hydroxyoxan-2-yl]oxy-4-hydroxy-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-5-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]oxolan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 789d245f-de5d-413e-97bd-0e9e9ab95d78 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
IUPAC Name | [(2S,3S,4R,5R)-2-[(2R,3S,4S,5S,6R)-3,5-diacetyloxy-6-(acetyloxymethyl)-4-hydroxyoxan-2-yl]oxy-4-hydroxy-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-5-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]oxolan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2(C(C(C(O2)COC(=O)C=CC3=CC(=C(C=C3)O)OC)O)OC(=O)C=CC4=CC(=C(C=C4)O)OC)COC(=O)C=CC5=CC=C(C=C5)O)OC(=O)C)O)OC(=O)C |
SMILES (Isomeric) | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)O[C@]2([C@H]([C@@H]([C@H](O2)COC(=O)/C=C/C3=CC(=C(C=C3)O)OC)O)OC(=O)/C=C/C4=CC(=C(C=C4)O)OC)COC(=O)/C=C/C5=CC=C(C=C5)O)OC(=O)C)O)OC(=O)C |
InChI | InChI=1S/C47H50O22/c1-25(48)61-23-37-43(64-26(2)49)42(58)44(65-27(3)50)46(66-37)69-47(24-63-39(55)17-10-28-6-13-31(51)14-7-28)45(67-40(56)19-12-30-9-16-33(53)35(21-30)60-5)41(57)36(68-47)22-62-38(54)18-11-29-8-15-32(52)34(20-29)59-4/h6-21,36-37,41-46,51-53,57-58H,22-24H2,1-5H3/b17-10+,18-11+,19-12+/t36-,37-,41-,42+,43-,44+,45+,46-,47+/m1/s1 |
InChI Key | YWJVWLXJQRVTIF-RIJIINLXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C47H50O22 |
Molecular Weight | 966.90 g/mol |
Exact Mass | 966.27937322 g/mol |
Topological Polar Surface Area (TPSA) | 305.00 Ų |
XlogP | 3.00 |
There are no found synonyms. |
![2D Structure of [(2S,3S,4R,5R)-2-[(2R,3S,4S,5S,6R)-3,5-diacetyloxy-6-(acetyloxymethyl)-4-hydroxyoxan-2-yl]oxy-4-hydroxy-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-5-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]oxolan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2S,3S,4R,5R)-2-[(2R,3S,4S,5S,6R)-3,5-diacetyloxy-6-(acetyloxymethyl)-4-hydroxyoxan-2-yl]oxy-4-hydroxy-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-5-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]oxolan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/b7e7ac30-87c7-11ee-9b84-8d211bc9b438.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.70% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.06% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 94.01% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.57% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.56% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.24% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.98% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.73% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.63% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.20% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.46% | 95.50% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.13% | 97.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.18% | 99.17% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.85% | 89.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.78% | 91.19% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 86.47% | 97.03% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.35% | 91.49% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.09% | 96.95% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.50% | 85.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.49% | 95.89% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.99% | 89.67% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.94% | 97.36% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.78% | 92.50% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.42% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.60% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.06% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Smilax glabra |
PubChem | 163194874 |
LOTUS | LTS0112786 |
wikiData | Q105366802 |