2-(hydroxymethyl)-6-[[17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol
Internal ID | 75db1e77-e343-47f1-bfca-0f7ed8a574c5 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 2-(hydroxymethyl)-6-[[17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol |
SMILES (Canonical) | CC(C)CCC(C(C)C1C(CC2C1(CCC3C2CC=C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)OC6C(C(C(C(O6)CO)O)O)O)O |
SMILES (Isomeric) | CC(C)CCC(C(C)C1C(CC2C1(CCC3C2CC=C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)OC6C(C(C(C(O6)CO)O)O)O)O |
InChI | InChI=1S/C39H66O13/c1-18(2)6-9-25(42)19(3)29-26(50-37-35(48)33(46)31(44)28(17-41)52-37)15-24-22-8-7-20-14-21(10-12-38(20,4)23(22)11-13-39(24,29)5)49-36-34(47)32(45)30(43)27(16-40)51-36/h7,18-19,21-37,40-48H,6,8-17H2,1-5H3 |
InChI Key | QOAMLEXTNGMRLG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H66O13 |
Molecular Weight | 742.90 g/mol |
Exact Mass | 742.45034216 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of 2-(hydroxymethyl)-6-[[17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol 2D Structure of 2-(hydroxymethyl)-6-[[17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/b558a100-8577-11ee-8fb3-5bcceb28535c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.25% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.68% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.02% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.95% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.75% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.71% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.06% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.00% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.04% | 85.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.66% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 89.68% | 98.10% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 89.68% | 94.08% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.56% | 98.05% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.54% | 97.79% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.67% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.19% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.17% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.43% | 89.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.08% | 89.05% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.98% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.91% | 97.14% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.91% | 94.62% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.79% | 94.23% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.22% | 90.08% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.09% | 89.67% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.36% | 97.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.18% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ruscus hypophyllum |
PubChem | 163004516 |
LOTUS | LTS0100129 |
wikiData | Q105224764 |