6-[[8a-(Acetyloxymethyl)-8,9-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-10-(2-methylbut-2-enoyloxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[4,5-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Internal ID | 8e0042d3-21a5-4dab-8391-5112430742f0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 6-[[8a-(acetyloxymethyl)-8,9-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-10-(2-methylbut-2-enoyloxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[4,5-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)OC6C(C(C(C(O6)C(=O)O)O)OC7C(C(C(CO7)O)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)COC(=O)C)O |
SMILES (Isomeric) | CC=C(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)OC6C(C(C(C(O6)C(=O)O)O)OC7C(C(C(CO7)O)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)COC(=O)C)O |
InChI | InChI=1S/C59H92O26/c1-11-24(2)49(75)85-47-46(72)59(23-78-25(3)61)27(18-54(47,4)5)26-12-13-32-56(8)16-15-34(55(6,7)31(56)14-17-57(32,9)58(26,10)19-33(59)64)80-53-45(84-51-40(70)38(68)37(67)30(20-60)79-51)42(41(71)43(82-53)48(73)74)81-52-44(36(66)29(63)22-77-52)83-50-39(69)35(65)28(62)21-76-50/h11-12,27-47,50-53,60,62-72H,13-23H2,1-10H3,(H,73,74) |
InChI Key | WAICKBYMIHVFCN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C59H92O26 |
Molecular Weight | 1217.30 g/mol |
Exact Mass | 1216.58768304 g/mol |
Topological Polar Surface Area (TPSA) | 407.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
![2D Structure of 6-[[8a-(Acetyloxymethyl)-8,9-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-10-(2-methylbut-2-enoyloxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[4,5-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid 2D Structure of 6-[[8a-(Acetyloxymethyl)-8,9-dihydroxy-4,4,6a,6b,11,11,14b-heptamethyl-10-(2-methylbut-2-enoyloxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[4,5-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/b372c5f0-883b-11ee-b382-dfd488339780.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.52% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.69% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.02% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.17% | 90.17% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 91.10% | 91.65% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 90.64% | 93.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.63% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.09% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.39% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.46% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.44% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.38% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.97% | 91.24% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.85% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 85.05% | 97.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.00% | 97.36% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.61% | 95.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.58% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.52% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.43% | 92.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.65% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.14% | 99.17% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.21% | 96.77% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.71% | 91.07% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.49% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.44% | 89.00% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.39% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia sinensis |
PubChem | 85212625 |
LOTUS | LTS0217145 |
wikiData | Q105300228 |