[(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S,3S)-3-acetyloxy-2-hydroxy-2-methylbutanoate
Internal ID | 4fd85c7c-cb73-4528-847a-5735579b6819 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Cerveratrum-type alkaloids |
IUPAC Name | [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S,3S)-3-acetyloxy-2-hydroxy-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2C(CN3CC(CCC3C2(C)O)C)C4C1(C5C(CC6C7(C5(C4)OC6(C(CC7)OC(=O)C(C)(C(C)OC(=O)C)O)O)C)OC(=O)C)O)O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@H]1[C@@H]([C@H]2[C@@H](CN3C[C@H](CC[C@H]3[C@@]2(C)O)C)[C@H]4[C@@]1([C@@H]5[C@@H](C[C@H]6[C@]7([C@]5(C4)O[C@@]6([C@H](CC7)OC(=O)[C@](C)([C@H](C)OC(=O)C)O)O)C)OC(=O)C)O)O |
InChI | InChI=1S/C41H63NO14/c1-10-20(3)34(46)55-33-31(45)30-24(18-42-17-19(2)11-12-28(42)38(30,9)49)25-16-39-32(40(25,33)50)26(53-23(6)44)15-27-36(39,7)14-13-29(41(27,51)56-39)54-35(47)37(8,48)21(4)52-22(5)43/h19-21,24-33,45,48-51H,10-18H2,1-9H3/t19-,20+,21-,24-,25-,26+,27-,28-,29-,30+,31+,32+,33-,36-,37-,38+,39+,40-,41-/m0/s1 |
InChI Key | KBGNYIWYDYVUFP-XTYFUDMMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H63NO14 |
Molecular Weight | 793.90 g/mol |
Exact Mass | 793.42485568 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | 2.00 |
Atomic LogP (AlogP) | 1.61 |
H-Bond Acceptor | 15 |
H-Bond Donor | 5 |
Rotatable Bonds | 8 |
There are no found synonyms. |
![2D Structure of [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S,3S)-3-acetyloxy-2-hydroxy-2-methylbutanoate 2D Structure of [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S,3S)-3-acetyloxy-2-hydroxy-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/b1313490-8325-11ee-bf96-af2f5103bd5c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.5519 | 55.19% |
Caco-2 | - | 0.8702 | 87.02% |
Blood Brain Barrier | + | 0.7500 | 75.00% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Lysosomes | 0.4815 | 48.15% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9029 | 90.29% |
OATP1B3 inhibitior | + | 0.9459 | 94.59% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | + | 0.6966 | 69.66% |
P-glycoprotein inhibitior | + | 0.7755 | 77.55% |
P-glycoprotein substrate | + | 0.7330 | 73.30% |
CYP3A4 substrate | + | 0.7502 | 75.02% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7867 | 78.67% |
CYP3A4 inhibition | - | 0.8503 | 85.03% |
CYP2C9 inhibition | - | 0.8986 | 89.86% |
CYP2C19 inhibition | - | 0.8913 | 89.13% |
CYP2D6 inhibition | - | 0.9269 | 92.69% |
CYP1A2 inhibition | - | 0.9276 | 92.76% |
CYP2C8 inhibition | + | 0.7703 | 77.03% |
CYP inhibitory promiscuity | - | 0.9277 | 92.77% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.5385 | 53.85% |
Eye corrosion | - | 0.9892 | 98.92% |
Eye irritation | - | 0.9090 | 90.90% |
Skin irritation | - | 0.7703 | 77.03% |
Skin corrosion | - | 0.9350 | 93.50% |
Ames mutagenesis | - | 0.6211 | 62.11% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4928 | 49.28% |
Micronuclear | + | 0.5400 | 54.00% |
Hepatotoxicity | - | 0.5053 | 50.53% |
skin sensitisation | - | 0.8856 | 88.56% |
Respiratory toxicity | + | 0.6444 | 64.44% |
Reproductive toxicity | + | 0.8667 | 86.67% |
Mitochondrial toxicity | + | 0.9750 | 97.50% |
Nephrotoxicity | + | 0.6265 | 62.65% |
Acute Oral Toxicity (c) | I | 0.7503 | 75.03% |
Estrogen receptor binding | + | 0.7415 | 74.15% |
Androgen receptor binding | + | 0.7567 | 75.67% |
Thyroid receptor binding | - | 0.5601 | 56.01% |
Glucocorticoid receptor binding | + | 0.7660 | 76.60% |
Aromatase binding | + | 0.6641 | 66.41% |
PPAR gamma | + | 0.7828 | 78.28% |
Honey bee toxicity | - | 0.6560 | 65.60% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | + | 0.5900 | 59.00% |
Fish aquatic toxicity | + | 0.7915 | 79.15% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.89% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.48% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.55% | 85.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.25% | 96.77% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 93.83% | 97.28% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.66% | 94.45% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.62% | 95.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 93.33% | 89.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.99% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 92.67% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.61% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.15% | 97.14% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 91.55% | 95.36% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 91.26% | 99.17% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.91% | 82.69% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.27% | 100.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.26% | 97.79% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 89.18% | 82.50% |
CHEMBL299 | P17252 | Protein kinase C alpha | 89.15% | 98.03% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.91% | 100.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 88.84% | 91.03% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.76% | 89.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.50% | 93.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.24% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.44% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.71% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.83% | 97.50% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 85.83% | 99.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.80% | 95.38% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.82% | 96.90% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.30% | 92.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.54% | 95.71% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.99% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.89% | 96.47% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 82.69% | 95.27% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.46% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.28% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.22% | 99.23% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.19% | 98.75% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 81.93% | 88.81% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.87% | 97.29% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.63% | 91.24% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.58% | 94.00% |
CHEMBL3045 | P05771 | Protein kinase C beta | 81.29% | 97.63% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.77% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.76% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.67% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.67% | 95.56% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.45% | 94.08% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.03% | 91.11% |
CHEMBL204 | P00734 | Thrombin | 80.01% | 96.01% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veratrum album |
PubChem | 163008235 |
LOTUS | LTS0201633 |
wikiData | Q105138199 |