8,9,9,13,14,25,26,27,30,31,32,39-Dodecahydroxy-3,18,21,36,38,40-hexaoxaoctacyclo[18.17.1.12,19.18,12.05,10.011,16.023,28.029,34]tetraconta-5,11,13,15,23,25,27,29,31,33-decaene-4,7,17,22,35-pentone
Internal ID | ca64bb11-e27c-4d06-b248-8f36509f26e5 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 8,9,9,13,14,25,26,27,30,31,32,39-dodecahydroxy-3,18,21,36,38,40-hexaoxaoctacyclo[18.17.1.12,19.18,12.05,10.011,16.023,28.029,34]tetraconta-5,11,13,15,23,25,27,29,31,33-decaene-4,7,17,22,35-pentone |
SMILES (Canonical) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)OC(=O)C6=CC(=C(C7=C6C8C(=CC(=O)C(C8(O)O)(O7)O)C(=O)O3)O)O)O |
SMILES (Isomeric) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)OC(=O)C6=CC(=C(C7=C6C8C(=CC(=O)C(C8(O)O)(O7)O)C(=O)O3)O)O)O |
InChI | InChI=1S/C34H24O23/c35-10-1-6-15(22(42)19(10)39)16-7(2-11(36)20(40)23(16)43)30(47)56-32-27-24(44)25(13(53-32)5-52-28(6)45)54-31(48)9-4-14(38)34(51)33(49,50)18(9)17-8(29(46)55-27)3-12(37)21(41)26(17)57-34/h1-4,13,18,24-25,27,32,35-37,39-44,49-51H,5H2 |
InChI Key | DOSGOFPXAZRTGO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H24O23 |
Molecular Weight | 800.50 g/mol |
Exact Mass | 800.07083701 g/mol |
Topological Polar Surface Area (TPSA) | 384.00 Ų |
XlogP | -1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.43% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.33% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.40% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.81% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.06% | 99.15% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.18% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.21% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.84% | 91.49% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 85.78% | 89.63% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.53% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.15% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.92% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.47% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Punica granatum |
PubChem | 73989171 |
LOTUS | LTS0055028 |
wikiData | Q104986165 |