Avenanthramide G
| Internal ID | 72be1612-8784-401b-98dd-9b2b4497b622 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acids > Avenanthramides |
| IUPAC Name | 4-hydroxy-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)NC2=C(C=CC(=C2)O)C(=O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)NC2=C(C=CC(=C2)O)C(=O)O)O |
| InChI | InChI=1S/C16H13NO5/c18-11-4-1-10(2-5-11)3-8-15(20)17-14-9-12(19)6-7-13(14)16(21)22/h1-9,18-19H,(H,17,20)(H,21,22)/b8-3+ |
| InChI Key | QSUPRDNLJSCNSD-FPYGCLRLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.07937252 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 2.60 |
| SCHEMBL9973825 |
| 4-Hydroxy-N-(4-hydroxycinnamoyl)anthranilic acid |
| N-(4'-hydroxy-(e)-cinnamoyl)-4-hydroxyanthranilic acid |
| 4-hydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]benzoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3194 | P02766 | Transthyretin | 94.45% | 90.71% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 94.19% | 81.11% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.13% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.93% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.49% | 86.33% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 87.92% | 87.67% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.89% | 97.36% |
| CHEMBL2568 | P06737 | Liver glycogen phosphorylase | 87.86% | 96.92% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.06% | 96.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.73% | 93.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.12% | 94.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.61% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.60% | 95.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.17% | 98.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.12% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.06% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Avena sativa |
| PubChem | 12003326 |
| LOTUS | LTS0261540 |
| wikiData | Q76422603 |