Avenanthramide B
Internal ID | 4f905d16-a39b-44da-8db5-5e36d8ef4a42 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acids > Avenanthramides |
IUPAC Name | 5-hydroxy-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)NC2=C(C=C(C=C2)O)C(=O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)NC2=C(C=C(C=C2)O)C(=O)O)O |
InChI | InChI=1S/C17H15NO6/c1-24-15-8-10(2-6-14(15)20)3-7-16(21)18-13-5-4-11(19)9-12(13)17(22)23/h2-9,19-20H,1H3,(H,18,21)(H,22,23)/b7-3+ |
InChI Key | JXFZHMCSCYADIX-XVNBXDOJSA-N |
Popularity | 10 references in papers |
Molecular Formula | C17H15NO6 |
Molecular Weight | 329.30 g/mol |
Exact Mass | 329.08993720 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 2.50 |
Avenanthramide 1 |
Avenanthramide BF |
Avenanthramide 2F |
108605-69-2 |
UNII-F8BQ5730IL |
F8BQ5730IL |
N-feruloyl-5-hydroxyanthranilic acid |
Benzoic acid, 5-hydroxy-2-(((2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl)amino)- |
(Z)-N-Feruloyl-5-hydroxyanthranilic acid |
5-hydroxy-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.12% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 95.91% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.09% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.21% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.21% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.97% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.59% | 99.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.90% | 95.50% |
CHEMBL2535 | P11166 | Glucose transporter | 88.42% | 98.75% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 88.20% | 90.20% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.69% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.44% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.17% | 89.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.80% | 99.15% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.78% | 81.11% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.27% | 97.36% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.11% | 94.42% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.62% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.12% | 91.19% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.09% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Avena sativa |
PubChem | 10087955 |
LOTUS | LTS0174884 |
wikiData | Q104981394 |