avenacin A-2
Internal ID | e6b9ff91-d3c4-47ab-b56e-5d6e4f8c1223 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(1S,3R,5R,6R,9S,10R,11R,14R,15S,17S,18S,20S,21R,23R)-21-formyl-17-hydroxy-9-[(2S,3R,4S,5S)-4-hydroxy-3,5-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]oxan-2-yl]oxy-10-(hydroxymethyl)-6,10,14,15,18,21-hexamethyl-2-oxahexacyclo[13.8.0.01,3.05,14.06,11.018,23]tricosan-20-yl] benzoate |
SMILES (Canonical) | CC12CCC(C(C1CCC3(C2CC4C5(C3(CC(C6(C5CC(C(C6)OC(=O)C7=CC=CC=C7)(C)C=O)C)O)C)O4)C)(C)CO)OC8C(C(C(CO8)OC9C(C(C(C(O9)CO)O)O)O)O)OC1C(C(C(C(O1)CO)O)O)O |
SMILES (Isomeric) | C[C@]12CC[C@@H]([C@@]([C@@H]1CC[C@@]3([C@@H]2C[C@@H]4[C@]5([C@]3(C[C@@H]([C@@]6([C@H]5C[C@@]([C@H](C6)OC(=O)C7=CC=CC=C7)(C)C=O)C)O)C)O4)C)(C)CO)O[C@H]8[C@@H]([C@H]([C@H](CO8)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
InChI | InChI=1S/C54H80O21/c1-48(23-57)17-31-50(3,19-35(48)72-44(67)25-10-8-7-9-11-25)32(59)18-53(6)52(5)15-12-29-49(2,30(52)16-34-54(31,53)75-34)14-13-33(51(29,4)24-58)73-47-43(74-46-42(66)40(64)37(61)27(21-56)70-46)38(62)28(22-68-47)71-45-41(65)39(63)36(60)26(20-55)69-45/h7-11,23,26-43,45-47,55-56,58-66H,12-22,24H2,1-6H3/t26-,27-,28+,29-,30-,31-,32+,33+,34-,35+,36-,37-,38+,39+,40+,41-,42-,43-,45+,46+,47+,48+,49+,50+,51+,52-,53+,54-/m1/s1 |
InChI Key | WFOVENUXZAPSIJ-TZLKGKMXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C54H80O21 |
Molecular Weight | 1065.20 g/mol |
Exact Mass | 1064.51920956 g/mol |
Topological Polar Surface Area (TPSA) | 334.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.20% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.98% | 86.33% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 94.55% | 94.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.26% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 92.86% | 97.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 92.24% | 94.08% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.93% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.88% | 95.56% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 90.70% | 89.44% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.06% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.01% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.83% | 95.89% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.61% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 87.16% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.92% | 99.23% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.15% | 97.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.68% | 99.17% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.65% | 92.98% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.45% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.41% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.24% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.65% | 97.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.32% | 96.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.88% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Avena fatua |
Avena sativa |
PubChem | 90658759 |
LOTUS | LTS0023817 |
wikiData | Q104395963 |