Atropuroside B
Internal ID | 8aeebf63-6e65-40b3-9e50-0c47f52926e5 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1R,2S,4S,5'R,6R,7S,8S,9S,12S,13R,14S,15S,16R)-14-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-8,15,16-triol |
SMILES (Canonical) | CC1CCC2(C(C3(C(O2)CC4C3(CCC5C4CC=C6C5(C(C(C(C6)O)O)OC7C(C(C(CO7)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)O)C)OC1 |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@H]([C@]3([C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5([C@@H]([C@H]([C@@H](C6)O)O)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)C)C)O)C)OC1 |
InChI | InChI=1S/C38H60O14/c1-16-8-11-37(48-14-16)18(3)38(46)25(52-37)13-22-20-7-6-19-12-23(39)28(43)32(36(19,5)21(20)9-10-35(22,38)4)51-34-31(27(42)24(40)15-47-34)50-33-30(45)29(44)26(41)17(2)49-33/h6,16-18,20-34,39-46H,7-15H2,1-5H3/t16-,17+,18-,20-,21+,22+,23-,24-,25+,26+,27+,28+,29-,30-,31-,32-,33+,34+,35+,36+,37-,38-/m1/s1 |
InChI Key | IIHRQLXJTOUCQO-XSJUWQEISA-N |
Popularity | 1 reference in papers |
Molecular Formula | C38H60O14 |
Molecular Weight | 740.90 g/mol |
Exact Mass | 740.39830658 g/mol |
Topological Polar Surface Area (TPSA) | 217.00 Ų |
XlogP | -0.10 |
(25R)-2alpha,3beta,17alpha-Trihydroxy-spirost-5-en-1beta-yl O-.alpha-L-rhamnopyranosyl(1-2)-.beta.-D-xylopyranoside |
(2R,5'R)-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-5'-tetramethyl-spiro[[?]-2,2'-tetrahydropyran]triol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.76% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.30% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.98% | 91.11% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 95.17% | 97.53% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.97% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.83% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.06% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.41% | 86.33% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 91.15% | 95.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.35% | 94.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.29% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.46% | 89.00% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 85.08% | 95.92% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.41% | 97.33% |
CHEMBL2581 | P07339 | Cathepsin D | 84.31% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.84% | 97.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.55% | 95.89% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.23% | 97.28% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.09% | 91.71% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.91% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.81% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.59% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.44% | 95.56% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 81.35% | 98.99% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.98% | 97.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.07% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Maianthemum atropurpureum |
PubChem | 11844040 |
LOTUS | LTS0055419 |
wikiData | Q105113486 |